|
|
| | Chloro(2-methylphenyl)bis(triphenylphosphine)nickel(II) Basic information | | Reaction |
| Product Name: | Chloro(2-methylphenyl)bis(triphenylphosphine)nickel(II) | | Synonyms: | Chloro(2-methylphenyl)bis(triphenylphosphine)nickel(II);BIS(TRIPHENYLPHOSPHINO)(2-METHYLPHENYL)CHLORONICKEL(II),99%;Bis(triphenylphosphino)(2-methylphenyl)chloronickel(II), 99%;2-[(7R,10S,13R,16R,19R,22S,25R)-25-amino-13-(4-aminobutyl)-7,22-dibenzyl-10-[(1R)-1-hydroxyethyl]-16,19-bis(1H-indol-3-ylmethyl)-6,9,12,15,18,21,24-heptaoxo-1,2-dithia-5,8,11,14,17,20,23-heptazacyclohexacos-5-yl]acetamide;Bis(triphenylphosphino)(2-methylphenyl)chloronickel;Bis(triphenylphosphine) (2-methylphenyl) Nickel(II) chloride;Buchwald nickel cross-coupling catalyst precursor;Bis(triphenylphosphino)(2-methylphenyl)chloronickel(II) | | CAS: | 27057-09-6 | | MF: | C43H39ClNiP2 | | MW: | 711.88 | | EINECS: | | | Product Categories: | | | Mol File: | 27057-09-6.mol |  |
| | Chloro(2-methylphenyl)bis(triphenylphosphine)nickel(II) Chemical Properties |
| Melting point | 195-200°C | | storage temp. | 2-8°C | | form | Powder | | color | yellow | | InChI | 1S/2C18H15P.C7H7.ClH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;;/h2*1-15H;2-5H,1H3;1H;/q;;;;+1/p-1 | | InChIKey | QVGJKVLYWZGANE-UHFFFAOYSA-M | | SMILES | Cl[Ni]C1=CC=CC=C1C.P(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.P(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7 | | CAS DataBase Reference | 27057-09-6 |
| WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Carc. 1B
Skin Sens. 1 |
| | Chloro(2-methylphenyl)bis(triphenylphosphine)nickel(II) Usage And Synthesis |
| Reaction |
- This complex is used as an air-stable nickel precatalyst for the amination of aryl chlorides, sulfamates, mesylates, and triflates.
- This nickel precatalyst is used for the polymerization of halothiophenes.
| | Uses | Product is a precursor to the synthesis of an air-stable Ni-precatalyst developed by Buchwald and coworkers. | | reaction suitability | core: nickel
reagent type: catalyst |
| | Chloro(2-methylphenyl)bis(triphenylphosphine)nickel(II) Preparation Products And Raw materials |
|