| Company Name: |
Changzhou Hopschain Chemical Co.,Ltd.
|
| Tel: |
85528066 13775048983 |
| Email: |
sales@hopschem.com |
| Products Intro: |
Product Name:4-chloro-5-(3,4-dimethylphenyl)thieno[2,3-d]pyrimidine
CAS:379241-56-2
Purity:95+% Package:100mg;250mg;500mg;1g;2.5g;5g;10g
|
| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 |
| Email: |
info@amateksci.com |
| Products Intro: |
Product Name:4-Chloro-5-(3,4-dimethylphenyl)thieno[2,3-d]pyrimidine
CAS:379241-56-2
Purity:97% HPLC Package:5g;25g;100g;1kg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:4-Chloro-5-(3,4-dimethylphenyl)thieno[2,3-d]pyrimidine
CAS:379241-56-2
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:4-chloro-5-(3,4-dimethylphenyl)thieno[2,3-d]pyrimidine
|
|
| | 4-CHLORO-5-(3,4-DIMETHYLPHENYL)THIENO[2,3-D]PYRIMIDINE Basic information |
| | 4-CHLORO-5-(3,4-DIMETHYLPHENYL)THIENO[2,3-D]PYRIMIDINE Chemical Properties |
| Boiling point | 432.4±45.0 °C(Predicted) | | density | 1.313±0.06 g/cm3(Predicted) | | pka | 0.40±0.40(Predicted) | | form | solid | | InChI | 1S/C14H11ClN2S/c1-8-3-4-10(5-9(8)2)11-6-18-14-12(11)13(15)16-7-17-14/h3-7H,1-2H3 | | InChIKey | YHGOZPYHUNWJBE-UHFFFAOYSA-N | | SMILES | ClC1=NC=NC2=C1C(C(C=C3C)=CC=C3C)=CS2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 4
Eye Irrit. 2 |
| | 4-CHLORO-5-(3,4-DIMETHYLPHENYL)THIENO[2,3-D]PYRIMIDINE Usage And Synthesis |
| | 4-CHLORO-5-(3,4-DIMETHYLPHENYL)THIENO[2,3-D]PYRIMIDINE Preparation Products And Raw materials |
|