DPP-C8C12-2Sn manufacturers
- DPP-C8C12-2Sn
-
- $349.00
-
2026-05-19
- CAS:1632459-72-3
- Min. Order: 100mg
- Purity: 97% min.
- Supply Ability: 1000g
|
| | DPP-C8C12-2Sn Basic information |
| Product Name: | DPP-C8C12-2Sn | | Synonyms: | DPP58;DPP-C8C12-2Sn;Pyrrolo[3,4-c]pyrrole-1,4-dione, 2,5-dihydro-2,5-bis(2-octyldodecyl)-3,6-bis[5-(trimethylstannyl)-2-thienyl]-;DPP812-2Sn;Dioctyldodecyl bis trimethyltin pyrrolidone diketone;2,5-bis(2-octyldodecyl)-3,6-bis(5-(trimethylstannyl)thiophen-2-yl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione | | CAS: | 1632459-72-3 | | MF: | C60H104N2O2S2Sn2 | | MW: | 1187.03 | | EINECS: | | | Product Categories: | | | Mol File: | 1632459-72-3.mol |  |
| | DPP-C8C12-2Sn Chemical Properties |
| Boiling point | 966.4±75.0 °C(Predicted) | | pka | -4.86±0.60(Predicted) | | InChIKey | XTNRYOIDJHBORO-UHFFFAOYSA-N | | SMILES | N1(CC(CCCCCCCC)CCCCCCCCCC)C(C2SC([Sn](C)(C)C)=CC=2)=C2C(=O)N(CC(CCCCCCCC)CCCCCCCCCC)C(C3SC([Sn](C)(C)C)=CC=3)=C2C1=O |
| | DPP-C8C12-2Sn Usage And Synthesis |
| | DPP-C8C12-2Sn Preparation Products And Raw materials |
|