|
|
| | 8-BROMOINOSINE Basic information |
| | 8-BROMOINOSINE Chemical Properties |
| Melting point | 180-190°C | | density | 2.45±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 8.09±0.70(Predicted) | | InChI | 1S/C10H11BrN4O5/c11-10-14-4-7(12-2-13-8(4)19)15(10)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H,12,13,19)/t3-,5-,6-,9-/m1/s1 | | InChIKey | XCAXTILLADBPII-UUOKFMHZSA-N | | SMILES | OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2c(Br)nc3C(=O)NC=Nc23 |
| Hazard Codes | T | | Risk Statements | 23-25-36-38 | | Safety Statements | 26-36-37-39-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 29389090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 8-BROMOINOSINE Usage And Synthesis |
| Chemical Properties | White to yellow solid | | Uses | 8-Bromoinosine is used in synthetic preparation of (bromo)adenosine, (bromo)guanosine derivatives via microwave-mediated regioselective and chemoselective bromination of adenosine, inosine and guanosine derivatives. 8-Bromoinosine is also used as reagent/reactant for preparation and immunostimulating activity of purine-substituted methylglucosamines via glycosylation of purines and methylglucosamine. |
| | 8-BROMOINOSINE Preparation Products And Raw materials |
|