|
|
| | PYRIFTALID Basic information |
| Product Name: | PYRIFTALID | | Synonyms: | PYRIFTALID;7-(4,6-DIMETHOXYPYRIMIN-2-YLTHIO)-3-METHYLISOBENZOFURAN-1(3H)-ONE;PYRIFTALID, PESTANAL;pyriftalid (bsi, pa iso);（RS）-7-（4，6-dimethyoxypryimidin-2-ylthio)-3-methyl-2-benzofuran-1 (3H)-one;Pyriftalid [iso];7-((4,6-DiMethoxypyriMidin-2-yl)thio)-3-Methylisobenzofuran-1(3H)-one;CGA 279233 | | CAS: | 135186-78-6 | | MF: | C15H14N2O4S | | MW: | 318.35 | | EINECS: | | | Product Categories: | | | Mol File: | 135186-78-6.mol |  |
| | PYRIFTALID Chemical Properties |
| Boiling point | 555.6±60.0 °C(Predicted) | | density | 1.39±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | -0.47±0.50(Predicted) | | Henry's Law Constant | 2.5×105 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | Major Application | agriculture
environmental | | InChI | 1S/C15H14N2O4S/c1-8-9-5-4-6-10(13(9)14(18)21-8)22-15-16-11(19-2)7-12(17-15)20-3/h4-8H,1-3H3 | | InChIKey | RRKHIAYNPVQKEF-UHFFFAOYSA-N | | SMILES | COc1cc(OC)nc(Sc2cccc3C(C)OC(=O)c23)n1 |
| WGK Germany | 2 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | PYRIFTALID Usage And Synthesis |
| Description | Pyriftalid is a rice herbicide. It has a low aqueous solubility and is semi-volatile. Whilst data is sparse it indicates that the chemical is not persistent in soil systems. It has a low mammalian toxicity and has a high potential for bioaccumulation. It is moderately toxic to birds, fish and honeybees. However, it poses a more serious risk to aquatic invertebrates. | | Chemical Properties | m.p.159～160℃ | | Uses | Pyriftalid is a pesticide. | | Definition | ChEBI: Pyriftalid is a member of 2-benzofurans. | | Production Methods | Pyriftalid is synthesised through a five-step process that begins with 3-nitrophthalic acid as the starting material. A key innovation in its production is the direct substitution of a nitro group with a mercapto group, using sodium sulphide and elemental sulphur, which eliminates the need for hazardous catalytic reduction and diazotization steps. This transformation forms a crucial intermediate that is then reacted with 4,6-dimethoxy-1H-pyrimidine-2-thione to build the herbicidal core. | | General Description | Pyriftalid is a pyrimidinyloxybenzoic herbicide used for the control of grass weeds in rice. Its mode of action involves inhibiting the biosynthesis of amino acids in weeds. | | Mechanism of action | Taken up mainly by roots. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS. | | Pesticide Type | Herbicide |
| | PYRIFTALID Preparation Products And Raw materials |
|