|
|
| | 3-Chlorocarbonyl-1-methanesulfonyl-2-imidazolidinone Basic information |
| | 3-Chlorocarbonyl-1-methanesulfonyl-2-imidazolidinone Chemical Properties |
| Melting point | 168-173 °C (lit.) | | Boiling point | 347.9±25.0 °C(Predicted) | | density | 1.71±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | -2.60±0.20(Predicted) | | InChI | InChI=1S/C5H7ClN2O4S/c1-13(11,12)8-3-2-7(4(6)9)5(8)10/h2-3H2,1H3 | | InChIKey | ZWTPALHHEULAPI-UHFFFAOYSA-N | | SMILES | C(Cl)(N1C(=O)N(S(C)(=O)=O)CC1)=O | | CAS DataBase Reference | 41762-76-9(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29332900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3-Chlorocarbonyl-1-methanesulfonyl-2-imidazolidinone Usage And Synthesis |
| Description | 3-Chlorocarbonyl-1-methanesulfonyl-2-imidazolidinone is a pharmaceutical intermediate, which can be used to prepare mezlocillin sodium. Mezlocillin sodium is one of the national essential medicines. It is the downstream product of penicillin industrial salt and is a third-generation semi-synthetic broad-spectrum antibiotic. | | Uses | 3-Chlorocarbonyl-1-methanesulfonyl-2-imidazolidinone is an important pharmaceutical intermediate, mainly used in the synthesis of mezlocillin, etc., mainly used in laboratory research and development process and chemical and pharmaceutical production process. |
| | 3-Chlorocarbonyl-1-methanesulfonyl-2-imidazolidinone Preparation Products And Raw materials |
|