- CAPROLACTAMDISULFIDE
-
- $1.10
-
2025-11-18
- CAS:23847-08-7
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
- Caprolactamdisulfide
-
- $200.00
-
2025-04-15
- CAS:23847-08-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20ton
- CAPROLACTAMDISULFIDE
-
- $1.00
-
2020-03-05
- CAS:23847-08-7
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons
|
| | CAPROLACTAMDISULFIDE Basic information |
| Product Name: | CAPROLACTAMDISULFIDE | | Synonyms: | 1,1’-dithiobis[hexahydro-2H-Azepin-2-one;2H-Azepin-2-one, 1,1-dithiobishexahydro-;1,1'-Dithiobis(hexahydro-1H-azepine-2-one);1,1'-Dithiobis[4,5,6,7-tetrahydro-1H-azepine-2(3H)-one];Einecs 245-910-0;N,N'-Caprolactam disulfide;N,N'-Dicaprolactam disulfide;N,N'-Dithiobis(hexahydro-2H-azepinone) | | CAS: | 23847-08-7 | | MF: | C12H20N2O2S2 | | MW: | 288.43 | | EINECS: | 245-910-0 | | Product Categories: | | | Mol File: | 23847-08-7.mol |  |
| | CAPROLACTAMDISULFIDE Chemical Properties |
| Boiling point | 422.3±28.0 °C(Predicted) | | density | 1.28 | | vapor pressure | 0.06Pa at 25℃ | | storage temp. | 2-8°C, stored under nitrogen | | pka | -1.18±0.20(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | 1.4g/L at 25℃ | | InChI | InChI=1S/C12H20N2O2S2/c15-11-7-3-1-5-9-13(11)17-18-14-10-6-2-4-8-12(14)16/h1-10H2 | | InChIKey | LGBYJXBCVZKJBL-UHFFFAOYSA-N | | SMILES | S(N1CCCCCC1=O)SN1CCCCCC1=O | | LogP | 2.25 at 30℃ | | EPA Substance Registry System | 2H-Azepin-2-one, 1,1'-dithiobis[hexahydro- (23847-08-7) |
| TSCA | TSCA listed | | HS Code | 2933998090 |
| | CAPROLACTAMDISULFIDE Usage And Synthesis |
| | CAPROLACTAMDISULFIDE Preparation Products And Raw materials |
|