FMOC-L-9-ANTHRYLALANINE manufacturers
|
| | FMOC-L-9-ANTHRYLALANINE Basic information |
| | FMOC-L-9-ANTHRYLALANINE Chemical Properties |
| Boiling point | 756.3±55.0 °C(Predicted) | | density | 1.311±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.77±0.30(Predicted) | | Appearance | Light yellow to yellow Solid | | Major Application | peptide synthesis | | InChIKey | OGLRHZZGDZRSHK-JZEPPUFONA-N | | SMILES | C1(COC(=O)N[C@H](C(=O)O)CC2C3C=CC=CC=3C=C3C=CC=CC=23)C2C=CC=CC=2C2C=CC=CC1=2 |&1:6,r| |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | FMOC-L-9-ANTHRYLALANINE Usage And Synthesis |
| Chemical Properties | Off-white to yellowish powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-L-9-ANTHRYLALANINE Preparation Products And Raw materials |
|