|
|
| | (2,2-DIMETHYL-[1,3]-DIOXOLAN-4-YL)-METHYLAMINE Basic information |
| Product Name: | (2,2-DIMETHYL-[1,3]-DIOXOLAN-4-YL)-METHYLAMINE | | Synonyms: | 2,2-DIMETHYL-1,3-DIOXOLANE-4-METHANAMINE;(2,2-DIMETHYL-[1,3]-DIOXOLAN-4-YL)-METHYLAMINE;2,2-DiMethyl-1,3-dioxolane-4-MethanaMine 97%;1,3-Dioxolane-4-methanamine, 2,2-dimethyl-;2,2-Dimethyl-1,3-Dioxolane-4-Methanamine97%;2,2-DIMETHYL-1,3-DIOXOLAN-4-METHYLAMINE;(2,2-DiMethyl-[1,3]-dioxolan-4-YL)-MethanaMine;2,2-dimethyl-1,3-dioxypentylcyclo-4-methylamine | | CAS: | 22195-47-7 | | MF: | C6H13NO2 | | MW: | 131.17 | | EINECS: | | | Product Categories: | Building Blocks;Chemical Synthesis;Heterocyclic Building Blocks;O-Containing;Others;Heterocyclic Building Blocks | | Mol File: | 22195-47-7.mol | ![(2,2-DIMETHYL-[1,3]-DIOXOLAN-4-YL)-METHYLAMINE Structure](CAS/GIF/22195-47-7.gif) |
| | (2,2-DIMETHYL-[1,3]-DIOXOLAN-4-YL)-METHYLAMINE Chemical Properties |
| Boiling point | 147-148 °C14 mm Hg(lit.) | | density | 1.012 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.438(lit.) | | Fp | 155 °F | | storage temp. | Storage temp. -20°C | | form | Liquid | | pka | 9.16±0.29(Predicted) | | color | Colorless to yellow | | InChI | InChI=1S/C6H13NO2/c1-6(2)8-4-5(3-7)9-6/h5H,3-4,7H2,1-2H3 | | InChIKey | HXOYWCSTHVTLOW-UHFFFAOYSA-N | | SMILES | O1CC(CN)OC1(C)C |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 2735 8/PG 2 | | WGK Germany | 3 | | HS Code | 29329900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | (2,2-DIMETHYL-[1,3]-DIOXOLAN-4-YL)-METHYLAMINE Usage And Synthesis |
| | (2,2-DIMETHYL-[1,3]-DIOXOLAN-4-YL)-METHYLAMINE Preparation Products And Raw materials |
| Raw materials | 1H-Isoindole-1,3(2H)-dione, 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]--->1,3-Dioxolane, 4-(iodomethyl)-2,2-dimethyl--->4-(azidomethyl)-2,2-dimethyl-1,3-dioxolane-->(S)-2,2-Dimethyl-1,3-dioxolane-4-methanol p-toluenesulfonate-->(S)-Glyceraldehyde acetonide-->(R)-(-)-2,2-Dimethyl-1,3-dioxolane-4-methanol-->(+)-5,6-O-Isopropylidene-L-ascorbic acid-->2,2-Dimethoxypropane-->2,2-Dimethyl-1,3-dioxolane-4-methanol |
|