EXO-NORBORNEOL manufacturers
- EXO-NORBORNEOL
-
- $30.00
-
2025-12-12
- CAS:497-37-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 3000KG
|
| | EXO-NORBORNEOL Basic information |
| | EXO-NORBORNEOL Chemical Properties |
| Melting point | 124-126 °C(lit.) | | Boiling point | 176-177 °C(lit.) | | density | 0.9086 (rough estimate) | | refractive index | 1.4460 (estimate) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 15.31±0.20(Predicted) | | form | Solid | | color | White to Off-White | | InChI | 1S/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6+,7+/m1/s1 | | InChIKey | ZQTYQMYDIHMKQB-VQVTYTSYSA-N | | SMILES | O[C@H]1C[C@@H]2CC[C@H]1C2 | | EPA Substance Registry System | Exo-norborneol (497-37-0) |
| WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2906190090 | | Storage Class | 11 - Combustible Solids |
| | EXO-NORBORNEOL Usage And Synthesis |
| Chemical Properties | white to light beige adhering powder | | Uses | exo-Norborneol was used in the synthesis of cyclic ketones. |
| | EXO-NORBORNEOL Preparation Products And Raw materials |
|