|
|
| | N-METHYL-N-BENZYLANILINE Basic information |
| | N-METHYL-N-BENZYLANILINE Chemical Properties |
| Melting point | 9.3°C | | Boiling point | 318 °C(lit.) | | density | 1.04 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.605(lit.) | | Fp | 110 °C | | storage temp. | Store below +30°C. | | solubility | 0.009g/l | | pka | 4.38±0.50(Predicted) | | form | liquid | | Water Solubility | 0.009g/L | | FreezingPoint | 8℃ | | InChI | InChI=1S/C14H15N/c1-15(14-10-6-3-7-11-14)12-13-8-4-2-5-9-13/h2-11H,12H2,1H3 | | InChIKey | LXZGVFCKZRHKMU-UHFFFAOYSA-N | | SMILES | C1(CN(C)C2=CC=CC=C2)=CC=CC=C1 | | CAS DataBase Reference | 614-30-2(CAS DataBase Reference) | | EPA Substance Registry System | Benzenemethanamine, N-methyl-N-phenyl- (614-30-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | Autoignition Temperature | 450 °C DIN 51794 | | TSCA | TSCA listed | | HS Code | 2921 49 00 | | Storage Class | 10 - Combustible liquids | | Toxicity | LD50 orally in Rabbit: 2130 mg/kg |
| | N-METHYL-N-BENZYLANILINE Usage And Synthesis |
| Uses | N-Benzyl-N-methylaniline is a tertiary amine and a useful building block, used in the synthetic preparation of fused tetrahydroquinolines via oxidative cyclization of anilines with maleimides. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 60, p. 2677, 1995 DOI: 10.1021/jo00114a014 |
| | N-METHYL-N-BENZYLANILINE Preparation Products And Raw materials |
|