| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Ethyl-a,a-d2-benzene-d5
CAS:84272-90-2
Remarks:CS-C-02150
|
| Company Name: |
ChengDu SinoStandards Bio-Tech Co.,Ltd. ，
|
| Tel: |
028-83243028 19136088901 |
| Email: |
sinostandards@163.com |
| Products Intro: |
Product Name:Ethyl-alpha,alpha-d2-benzene-d5
CAS:84272-90-2
Purity:標(biāo)準(zhǔn)品 Package:10mg;100mg;1g
|
| Company Name: |
Yancheng Tongming Biotechnology Co., Ltd.
|
| Tel: |
15195160625 |
| Email: |
2863565288@qq.com |
| Products Intro: |
Product Name:Ethyl-α,α-d2-benzene-d5
CAS:84272-90-2
Purity:98% HPLC Package:0.1 g In Stock
0.25 g In Stock
|
| Company Name: |
LGC Science (Shanghai) Ltd.
|
| Tel: |
17717235263 |
| Email: |
fan.yang@LGCgroup.com |
| Products Intro: |
Product Name:Ethyl-alpha,alpha-d2-benzene-d5
CAS:84272-90-2
Purity:具體純度，見(jiàn)COA Package:0.1g Remarks:CDN-D-1904
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Ethyl-1,1-d2 benzene-d5
CAS:84272-90-2
|
|
| | ETHYL-ALPHA,ALPHA-D2-BENZENE-D5 Basic information |
| Product Name: | ETHYL-ALPHA,ALPHA-D2-BENZENE-D5 | | Synonyms: | ETHYL-ALPHA,ALPHA-D2-BENZENE-D5;ETHYL-1,1-D2 BENZENE-D5;ETHYL-1,1-D2 BENZENE-D5, 99% CHEMICAL PU;Ethyl-α,α-D2-benzene-D5;Ethyl-a,a-d2-benzene-d5;1,2,3,4,5-pentadeuterio-6-(1,1-dideuterioethyl)benzene;Ethyl-1,1-d2 benzene-d5 | | CAS: | 84272-90-2 | | MF: | C8H10 | | MW: | 106.17 | | EINECS: | | | Product Categories: | Alphabetical Listings;E-F;Stable Isotopes | | Mol File: | 84272-90-2.mol |  |
| | ETHYL-ALPHA,ALPHA-D2-BENZENE-D5 Chemical Properties |
| Boiling point | 136 °C(lit.) | | density | 0.923 g/mL at 25 °C | | Fp | 72 °F | | InChI | 1S/C8H10/c1-2-8-6-4-3-5-7-8/h3-7H,2H2,1H3/i2D2,3D,4D,5D,6D,7D | | InChIKey | YNQLUTRBYVCPMQ-GGTYFICESA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C([2H])([2H])C |
| Hazard Codes | F,Xn | | Risk Statements | 11-20 | | Safety Statements | 16-24/25-29 | | RIDADR | UN 1175 3/PG 2 | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Inhalation
Aquatic Chronic 3
Asp. Tox. 1
Flam. Liq. 2
STOT RE 2 |
| | ETHYL-ALPHA,ALPHA-D2-BENZENE-D5 Usage And Synthesis |
| Uses | Ethyl-alpha,alpha-d2-benzene-d5 (CAS# 84272-90-2) is a useful isotopically labeled research compound. |
| | ETHYL-ALPHA,ALPHA-D2-BENZENE-D5 Preparation Products And Raw materials |
|