| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Urapidil Impurity 26
CAS:34661-85-3
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
URAPIDIL 5-METHYL- manufacturers
|
| | URAPIDIL 5-METHYL- Basic information |
| Product Name: | URAPIDIL 5-METHYL- | | Synonyms: | URAPIDIL, 5-METHYL SELECTIVE A1A ADRENOC;5-methylurapidil;5-MU;6-[[3-[4-(2-Methoxyphenyl)-1-piperazinyl]propyl]amino]-1,3,5-trimethyluracil;6-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,3,5-trimethylpyrimidine-2,4-dione;Urapidil Impurity 11;Urapidil Impurity 26;2,4(1H,3H)-Pyrimidinedione, 6-[[3-[4-(2-methoxyphenyl)-1-piperazinyl]propyl]amino]-1,3,5-trimethyl- | | CAS: | 34661-85-3 | | MF: | C21H31N5O3 | | MW: | 401.5 | | EINECS: | | | Product Categories: | | | Mol File: | 34661-85-3.mol |  |
| | URAPIDIL 5-METHYL- Chemical Properties |
| Boiling point | 555.6±60.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | solubility | H2O: 0.4 mg/mL | | form | solid | | pka | 7.79±0.10(Predicted) | | color | white | | Water Solubility | H2O: 0.4mg/mL
0.1 M HCl: 3.8mg/mL | | InChI | 1S/C21H31N5O3.ClH/c1-16-19(23(2)21(28)24(3)20(16)27)22-10-7-11-25-12-14-26(15-13-25)17-8-5-6-9-18(17)29-4;/h5-6,8-9,22H,7,10-15H2,1-4H3;1H | | InChIKey | WAZDYFHTLYHMKO-UHFFFAOYSA-N | | SMILES | Cl[H].COc1ccccc1N2CCN(CCCNC3=C(C)C(=O)N(C)C(=O)N3C)CC2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | URAPIDIL 5-METHYL- Usage And Synthesis |
| Uses | 5-Methylurapidil is a selective alpha-1A-adrenergic receptor antagonist. | | Biological Activity | Selective α1A-adrenoceptor antagonist; antihypertensive. |
| | URAPIDIL 5-METHYL- Preparation Products And Raw materials |
|