| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2,5-Bis(hexyloxy)benzene-1,4-diacetonitrile CAS:151903-53-6 Purity:98% Package:1G Remarks:560693-1G
|
| Company Name: |
Zhengzhou Huiju Chemical Co., Ltd.
|
| Tel: |
0371-55900031 18137872243 |
| Email: |
3927209986@qq.com |
| Products Intro: |
Product Name:2,5-Bis(hexyloxy)benzene-1,4-diacetonitrile CAS:151903-53-6 Purity:98% Package:1g ;5g ;10g ;25g ;100g ;500g ;1kg ;5kg
|
|
| | 2 5-BIS(HEXYLOXY)BENZENE-1 4-DIACETONIT& Basic information |
| | 2 5-BIS(HEXYLOXY)BENZENE-1 4-DIACETONIT& Chemical Properties |
| Melting point | 93.9-98.2 °C(lit.) | | InChI | 1S/C22H32N2O2/c1-3-5-7-9-15-25-21-17-20(12-14-24)22(18-19(21)11-13-23)26-16-10-8-6-4-2/h17-18H,3-12,15-16H2,1-2H3 | | InChIKey | GFPGEWHJZPFZMC-UHFFFAOYSA-N | | SMILES | CCCCCCOc1cc(CC#N)c(OCCCCCC)cc1CC#N |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2 5-BIS(HEXYLOXY)BENZENE-1 4-DIACETONIT& Usage And Synthesis |
| Uses | Monomeric precursor for the light-emitting polymer OC6C6-CN-PPV (or DHeO-CN-PPV) |
| | 2 5-BIS(HEXYLOXY)BENZENE-1 4-DIACETONIT& Preparation Products And Raw materials |
|