| Company Name: |
Henan Weituxi Chemical Technology Co., Ltd. Gold
|
| Tel: |
0371-63284658 18135795563 |
| Email: |
3905209149@qq.com |
| Products Intro: |
Product Name:Benzenamine, 4,4'-(1,2-diphenyl-1,2-ethenediyl)bis CAS:1809802-59-2 Purity:98% Package:100mg;250mg;500mg
|
|
| | Benzenamine, 4,4'-(1,2-diphenyl-1,2-ethenediyl)bis Basic information |
| Product Name: | Benzenamine, 4,4'-(1,2-diphenyl-1,2-ethenediyl)bis | | Synonyms: | Benzenamine, N-(diphenylmethylene)-2,6-bis(1-methylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;N-(Diphenylmethylene)-2,6-diisopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline | | CAS: | 1809802-59-2 | | MF: | C31H38BNO2 | | MW: | 467.45 | | EINECS: | | | Product Categories: | | | Mol File: | 1809802-59-2.mol |  |
| | Benzenamine, 4,4'-(1,2-diphenyl-1,2-ethenediyl)bis Chemical Properties |
| Boiling point | 564.0±50.0 °C(Predicted) | | density | 1.00±0.1 g/cm3(Predicted) | | pka | 2.65±0.50(Predicted) | | InChI | InChI=1S/C31H38BNO2/c1-21(2)26-19-25(32-34-30(5,6)31(7,8)35-32)20-27(22(3)4)29(26)33-28(23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-22H,1-8H3 | | InChIKey | BTVFDHLTURTLIF-UHFFFAOYSA-N | | SMILES | C1(/N=C(/C2=CC=CC=C2)\C2=CC=CC=C2)=C(C(C)C)C=C(B2OC(C)(C)C(C)(C)O2)C=C1C(C)C |
| | Benzenamine, 4,4'-(1,2-diphenyl-1,2-ethenediyl)bis Usage And Synthesis |
| | Benzenamine, 4,4'-(1,2-diphenyl-1,2-ethenediyl)bis Preparation Products And Raw materials |
|