| Company Name: |
Shanghai SPAR pharmaceutical technology co., LTD
|
| Tel: |
021-000000 13917643586; |
| Email: |
admin@jingshipharmatech.com |
| Products Intro: |
Product Name:4-chloro-2,3-dimethylthieno[2,3-b]pyridine-5-carbonitrile CAS:1014692-62-6 Purity:95% HPLC Package:1g:5g:10g:25g:50g:100g:250g:500g:1Kg:100Kg:
|
| Company Name: |
Shanghai Sunway Pharmaceutical Technology Co.,Ltd.
|
| Tel: |
13611835272 13611835272 |
| Email: |
mmwang@sunwaypharm.com |
| Products Intro: |
Product Name:Ademetionine 1,4-butanedisulfonate CAS:1014692-62-6 Purity:97% Package:0.1g;0.25g;1g;5g;10g;25g;100g;500g
|
| Company Name: |
Allbio pharm Co., Ltd
|
| Tel: |
1483287082 19962651230 |
| Email: |
sales@allbiopharm.com |
| Products Intro: |
Product Name:Ademetionine 1,4-butanedisulfonate CAS:1014692-62-6 Purity:95% HPLC Package:5G;100G;1KG
|
Ademetionine 1,4-butanedisulfonate manufacturers
|
| | Ademetionine 1,4-butanedisulfonate Basic information |
| | Ademetionine 1,4-butanedisulfonate Chemical Properties |
| Boiling point | 389.3±37.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | pka | 1.13±0.40(Predicted) | | InChI | InChI=1S/C10H7ClN2S/c1-5-6(2)14-10-8(5)9(11)7(3-12)4-13-10/h4H,1-2H3 | | InChIKey | APSQWHAHUIGFLU-UHFFFAOYSA-N | | SMILES | C12SC(C)=C(C)C1=C(Cl)C(C#N)=CN=2 |
| | Ademetionine 1,4-butanedisulfonate Usage And Synthesis |
| Definition | Ademetionine 1,4-butanedisulfonate consists of S-adenosyl-L-methionine (SAMe) bound to 1,4-butanedisulfonic acid. SAMe is a naturally occurring compound formed from methionine and ATP. SAMe is involved in methyl group transfers, which are essential for various biochemical processes, including the methylation of DNA, proteins, and lipids. |
| | Ademetionine 1,4-butanedisulfonate Preparation Products And Raw materials |
|