|
|
| | (1S)-(-)-Camphanic acid Basic information |
| Product Name: | (1S)-(-)-Camphanic acid | | Synonyms: | 4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid;(1S)-(-)-CAMPHANIC ACID;(1S)-3-OXO-4,7,7-TRIMETHYL-2-OXABICYCLO[2.2.1]HEPTANE-1-CARBOXYLIC ACID;(S)-(-)-1-CAMPHANIC ACID;(-) Camphenic acid;(3R,6S)-2-Oxo-3β,6β-isopropylidene-3-methyltetrahydro-2H-pyran-6-carboxylic acid;[1S,4R,(-)]-4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid;(-)-Camphanic acid,99% | | CAS: | 13429-83-9 | | MF: | C10H14O4 | | MW: | 198.22 | | EINECS: | 236-552-6 | | Product Categories: | FINE Chemical & INTERMEDIATES;Chemical intermediate for Efavirenz;Miscellaneous Natural Products;API intermediates;Analytical Chemistry;Bicyclic Monoterpenes;Biochemistry;e.e. / Absolute Configuration Determination (NMR);Enantiomer Excess & Absolute Configuration Determination;Terpenes;Chiral Compound | | Mol File: | 13429-83-9.mol |  |
| | (1S)-(-)-Camphanic acid Chemical Properties |
| Melting point | 201-205 °C | | Boiling point | 255.53°C (rough estimate) | | alpha | -18.5 º (c=1, dioxane) | | density | 1.0143 (rough estimate) | | refractive index | 1.4500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.36±0.60(Predicted) | | form | powder to crystaline | | color | White to Almost white | | Optical Rotation | [α]20/D 18°, c = 1 in dioxane | | BRN | 84570 | | InChI | InChI=1S/C10H14O4/c1-8(2)9(3)4-5-10(8,6(11)12)14-7(9)13/h4-5H2,1-3H3,(H,11,12)/t9-,10+/m0/s1 | | InChIKey | RKFCLVFAFZYVCG-WDEREUQCSA-N | | SMILES | [C@@]12(C(O)=O)C(C)(C)[C@@](C)(CC1)C(=O)O2 | | CAS DataBase Reference | 13429-83-9(CAS DataBase Reference) |
| | (1S)-(-)-Camphanic acid Usage And Synthesis |
| Chemical Properties | WHITE TO SLIGHTLY BEIGE CRYSTALLINE POWDER | | Uses | (1S)-(-)-Camphanic acid may be used in the preparation of (-)-(1S,4R)-camphanoyl chloride by reacting with thionyl chloride. | | Definition | ChEBI: (-)-camphanic acid is a delta-lactone. | | General Description | (1S)-(-)-Camphanic acid is commonly used as a chiral auxiliary for the separation of racemates. | | Purification Methods | Dissolve it in CH2Cl2, dry (MgSO4), filter, evaporate and the residue is sublimed at 120o/0.5mm or 140o/1mm. [Gerlach Helv Chim Acta 61 2773 1978, Beilstein 18/8 V 101.] |
| | (1S)-(-)-Camphanic acid Preparation Products And Raw materials |
|