|
|
| | 3-Methyl-4-aminopyridine Basic information |
| | 3-Methyl-4-aminopyridine Chemical Properties |
| Melting point | 106-107 | | Boiling point | 192.78°C (rough estimate) | | density | 0.9581 (rough estimate) | | refractive index | 1.5400 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | pka | pK1: 9.43(+1) (25°C) | | color | Crystals from C6H6/pet ether | | InChI | InChI=1S/C6H8N2/c1-5-4-8-3-2-6(5)7/h2-4H,1H3,(H2,7,8) | | InChIKey | VGJLGPCXUGIXRQ-UHFFFAOYSA-N | | SMILES | C1=NC=CC(N)=C1C | | CAS DataBase Reference | 1990-90-5(CAS DataBase Reference) |
| Hazard Codes | C,Xi,Xn | | Risk Statements | 23/24/25-36/37/38-34-22-20/21/22 | | Safety Statements | 22-36/37/39-45-36-27-26 | | RIDADR | 2811 | | WGK Germany | WGK 3 | | RTECS | TJ5140000 | | Hazard Note | Harmful | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral | | Toxicity | LD50 orl-rat: 446 mg/kg TXAPA9 21,315,72 |
| | 3-Methyl-4-aminopyridine Usage And Synthesis |
| Chemical Properties | Crystals | | Uses | 4-Amino-3-methylpyridine is a non depolarizing muscular relaxant with antagonist effect that functions on neuromuscular transmission and in central nervous systems in rats. A central cholinergic agent. | | Safety Profile | Moderately toxic by ingestion.When heated to decomposition it emits toxic fumes ofNOx. | | Synthesis | Step 2: A mixed solution of 3-methyl-4-nitropyridine-N-oxide (30.0 g, 195 mmol) with 10% palladium-carbon catalyst (6.0 g) in ethanol (450 mL) was subjected to a hydrogen atmosphere (5 bar) and the reaction was stirred at room temperature for 36 hours. Upon completion of the reaction, the reaction mixture was filtered through a diatomaceous earth pad to remove the catalyst, followed by evaporation of the solvent under reduced pressure to afford the target product 3-methyl-4-aminopyridine (20.0 g, 95% yield). | | References | [1] Nucleosides, Nucleotides and Nucleic Acids, 2002, vol. 21, # 11-12, p. 737 - 751
[2] Patent: WO2015/22073, 2015, A1. Location in patent: Page/Page column 39
[3] Patent: WO2005/63744, 2005, A2. Location in patent: Page/Page column 232
[4] Journal of the American Chemical Society, 1954, vol. 76, p. 4184
[5] Pharmaceutical Bulletin, 1956, vol. 4, p. 174,177 |
| | 3-Methyl-4-aminopyridine Preparation Products And Raw materials |
|