|
|
| | D-GLUCOSE-1-13C Basic information |
| | D-GLUCOSE-1-13C Chemical Properties |
| Melting point | 150-152 °C(lit.) | | storage temp. | Room Temperature | | solubility | Methanol (Slightly, Heated), Water | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D +52.0°, c = 2 in H2O (trace NH4OH) | | BRN | 2263682 | | InChI | InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6/s3/i6+1 | | InChIKey | WQZGKKKJIJFFOK-CPFUHCNBNA-N | | SMILES | [C@H]1(CO)O[13CH]([C@H](O)[C@@H](O)[C@@H]1O)O |&1:0,5,7,9,r| | | CAS Number Unlabeled | 50-99-7 |
| WGK Germany | 3 | | F | 3 | | HS Code | 28459000 | | Storage Class | 11 - Combustible Solids |
| | D-GLUCOSE-1-13C Usage And Synthesis |
| Chemical Properties | D-GLUCOSE-1-13C is White powder | | Uses | D-Glucose-1-13C can be used:
- To predict the primary reaction mechanism in pyrolysis of glucose.
- To study CC bond cleavage mechanism in the conversion of labeled glucose into alkanediols using NiMgOZnO catalyst.
- In tracer enrichment determination in blood plasma using high-resolution mass spectrometry.
| | Uses | D-GLUCOSE-1-13C is a simple sugar that is present in plants. A monosaccharide that may exist in open chain or cyclic conformation if in solution. It plays a vital role in photosynthesis and fuels the energy required for cellular respiration. D-Glucose is used in various metabolic processes including enzymic synthesis of cyclohexyl-α and β-D-glucosides. D-GLUCOSE-1-13C Can also be used as a diagnostic tool in detection of type 2 diabetes mellitus and potentially Huntington's disease through analysis of blood-glucose in type 1 diabetes mellitus. |
| | D-GLUCOSE-1-13C Preparation Products And Raw materials |
|