- Alisol B Acetate
-
-
2023-02-24
- CAS:26575-95-1
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- Alisol B acetate
-
- $1.00
-
2019-07-06
- CAS:26575-95-1
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100KG
|
| | Alisol B acetate Basic information |
| Product Name: | Alisol B acetate | | Synonyms: | (23S,24R)-24,25-Epoxy-11b,23-dihydroxy-8a,9b,14b-dammar-13(17)-en-3-one 23-acetate;Alisol B acetate;Alisol B 23-acetate,;(8α,9β,14β,23S,24R)-11β-Hydroxy-23-acetoxy-24,25-epoxy-5α-dammara-13(17)-ene-3-one;(8α,9β,14β,23S,24R)-23-Acetoxy-24,25-epoxy-11β-hydroxydammar-13(17)-en-3-one;Acetylalisol B;ALISOL B ACETATE(SH);23-O-Acetylalisol B | | CAS: | 26575-95-1 | | MF: | C32H50O5 | | MW: | 514.74 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 26575-95-1.mol |  |
| | Alisol B acetate Chemical Properties |
| Melting point | 162～163℃ | | Boiling point | 590.7±50.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.74±0.70(Predicted) | | color | White | | Major Application | food and beverages | | InChIKey | NLOAQXKIIGTTRE-CAMIZLLSNA-N | | SMILES | C[C@]12CC[C@@]3([H])C(C(=O)CC[C@]3(C)[C@]1([H])[C@H](CC1=C([C@H](C)C[C@@H]([C@@]3([H])OC3(C)C)OC(=O)C)CC[C@]21C)O)(C)C |&1:1,4,11,13,15,19,22,23,35,r| |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29153900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Alisol B acetate Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in methanol, derived from Alisma orientalis. | | Uses | Alisol B 23-Acetate is effective in reversing the multi-drug resistance of specific over-expressing P-glycoprotein cancer cells. An herbal triterpene extract that is useful in the treatment of cancers, primarily prostate cancer. | | Definition | ChEBI: Alisol b acetate is a triterpenoid. |
| | Alisol B acetate Preparation Products And Raw materials |
|