|
|
| | 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid Basic information |
| Product Name: | 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid | | Synonyms: | 6-Amino-1-naphthol-3,5-disulfonic acid;6-amino-1-hydroxy-3,5-naphthalenedisulfonic acid;7-amino-4-hydroxynaphthalene-2,8-disulfonic acid;2-amino-5-hydroxynaphthalene-1,7-disulphonic acid;2-amino-5-hydroxy-1,7-naphthalenedisulfonic acid;2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid;2-amino-5-naphthol-1,7-disulfonic acid;3-Amino-8-hydroxy-4,6-disulfonaphthalene | | CAS: | 6535-70-2 | | MF: | C10H9NO7S2 | | MW: | 319.31 | | EINECS: | 229-445-0 | | Product Categories: | | | Mol File: | 6535-70-2.mol |  |
| | 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid Chemical Properties |
| Boiling point | 603.18℃[at 101 325 Pa] | | density | 1.880 | | vapor pressure | 0Pa at 25℃ | | pka | -0.42±0.40(Predicted) | | Water Solubility | 35.36g/L at 25℃ | | InChI | InChI=1S/C10H9NO7S2/c11-8-2-1-6-7(10(8)20(16,17)18)3-5(4-9(6)12)19(13,14)15/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18) | | InChIKey | HIVUAOXLSJITPA-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=C2C(C(O)=CC(S(O)(=O)=O)=C2)=CC=C1N | | LogP | -2.33 at 25℃ | | CAS DataBase Reference | 6535-70-2(CAS DataBase Reference) |
| | 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid Usage And Synthesis |
| Uses | Sulfo J acid is used as a coupling component in azo reactive dyes, e.g., C.I. Reactive Red 6. | | Production Methods | 2-Aminonaphthalene-1,5,7-trisulfonic acid is heated with sodium hydroxide liquor at 170℃ and worked up in a similar way to the K acid. Alternatively, J acid may be sulfonated with 65 % oleum. | | Flammability and Explosibility | Not classified |
| | 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid Preparation Products And Raw materials |
|