- 1-Boc-7-azaindole
-
- $9.80
-
2020-01-14
- CAS:138343-77-8
- Min. Order: 1g
- Purity: ≥99%
- Supply Ability: 100kg
|
| | 1-Boc-7-azaindole Basic information |
| Product Name: | 1-Boc-7-azaindole | | Synonyms: | 1-(tert-Butoxycarbonyl)-7-azaindole, 1-(tert-Butoxycarbonyl)-1H-pyrrolo[2,3-b]pyridine;N-Boc-7-azaindole;1-BOC-Pyrrolo[2,3-b]pyridine;1-BOC-7-AZAINDOLE;1-BOC-7-AZAINDOLE, 98+%;7-Azaindole-1-carboxylic acid tert-butyl ester;1H-Pyrrolo[2,3-b]pyridine-1-carboxylic acid, 1,1-dimethylethyl ester;1-pyrrolo[2,3-b]pyridinecarboxylic acid tert-butyl ester | | CAS: | 138343-77-8 | | MF: | C12H14N2O2 | | MW: | 218.25 | | EINECS: | | | Product Categories: | | | Mol File: | 138343-77-8.mol |  |
| | 1-Boc-7-azaindole Chemical Properties |
| Boiling point | 327.2±34.0 °C(Predicted) | | density | 1.135 g/mL at 25 °C | | refractive index | n20/D 1.546 | | storage temp. | Room temperature. | | pka | 2.90±0.30(Predicted) | | form | liquid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C12H14N2O2/c1-12(2,3)16-11(15)14-8-6-9-5-4-7-13-10(9)14/h4-8H,1-3H3 | | InChIKey | SGZMGGUBXZBVPJ-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)n1ccc2cccnc12 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-Boc-7-azaindole Usage And Synthesis |
| Chemical Properties | Light yellow solid |
| | 1-Boc-7-azaindole Preparation Products And Raw materials |
|