|
|
| | FMOC-SER(TBU)-OPFP Basic information |
| Product Name: | FMOC-SER(TBU)-OPFP | | Synonyms: | N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-O-T-BUTYL-L-SERINE PENTAFLUORPHENOL ESTER;FMOC-SER(TBU)-OPFP;FMOC-SERINE(TBU)-OPFP;FMOC-L-SER(TBU)-OPFP;L-Serine,O-(1,1-dimethylethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-,2,3,4,5,6-pentafluorophenyl ester;Fmoc-Ser(tBu)-OPf;-OPfp;FMOC-O-TERT-BUTYL-L-SERINE PENTAFLUOROPHENYL ESTER | | CAS: | 105751-13-1 | | MF: | C28H24F5NO5 | | MW: | 549.49 | | EINECS: | | | Product Categories: | Fmoc-Amino Acids and Derivatives;Fmoc-Amino acid series | | Mol File: | 105751-13-1.mol |  |
| | FMOC-SER(TBU)-OPFP Chemical Properties |
| Melting point | 67-71℃ | | Boiling point | 628.2±55.0 °C(Predicted) | | density | 1.349±0.06 g/cm3(Predicted) | | storage temp. | Store at -15°C to -25°C. | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 9.82±0.46(Predicted) | | Appearance | brown oil | | Major Application | peptide synthesis | | InChIKey | DOUJYVMLNKRFHE-IBGZPJMESA-N | | SMILES | Fc1c(c(c(c(c1F)F)OC(=O)[C@@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)COC(C)(C)C)F)F |
| WGK Germany | 3 | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | FMOC-SER(TBU)-OPFP Usage And Synthesis |
| Uses | Fmoc-Ser(tBu)-OPfp is used as a reactant in the synthesis of peptides and peptide derivatives. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-SER(TBU)-OPFP Preparation Products And Raw materials |
|