|
|
| | JUVENILE HORMONE III Basic information |
| Product Name: | JUVENILE HORMONE III | | Synonyms: | C16-JUVENILE HORMONE;JUVENILE HORMONE III;JUVENILE HORMONE 11;JH II;JH-III;[+/-]-CIS-10,11-EPOXY-3,7,11-TRIMETHYL-TRANS,TRANS-2,6-DODECADIENOIC ACID METHYL ESTER;juvenile hormone-iii approx. 75%;methyl (2E,6E)-(±)-9-(3,3-dimethyloxiranyl)-3,7-dimethylnona-2,6-dienoate | | CAS: | 24198-95-6 | | MF: | C16H26O3 | | MW: | 266.38 | | EINECS: | 246-072-9 | | Product Categories: | | | Mol File: | 24198-95-6.mol |  |
| | JUVENILE HORMONE III Chemical Properties |
| Boiling point | 348.6±25.0 °C(Predicted) | | density | 0.966±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMF: 14 mg/ml; DMF:PBS(pH7.2) (1:2): 0.3 mg/ml; DMSO: 10 mg/ml; Ethanol: 12 mg/ml | | form | Oil | | color | Colourless to Pale Yellow | | biological source | synthetic (organic) | | BRN | 1316317 | | Stability: | Light Sensitive | | InChI | InChI=1S/C16H26O3/c1-12(9-10-14-16(3,4)19-14)7-6-8-13(2)11-15(17)18-5/h7,11,14H,6,8-10H2,1-5H3/b12-7+,13-11+ | | InChIKey | QVJMXSGZTCGLHZ-ZPLWXOMKSA-N | | SMILES | C(OC)(=O)/C=C(\C)/CC/C=C(\C)/CCC1C(C)(C)O1 |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 4 |
| | JUVENILE HORMONE III Usage And Synthesis |
| Uses | Juvenile hormone III has been used to:
- study the effect of juvenile hormone on mictic (sexual) female production of the rotifer Brachionus plicatilis Muller
- study the effect of juvenile hormone on head GB19811 (putative Takeout/juvenile hormone binding protein) mRNA levels in adult honeybees
- study the effect of juvenile hormone on gonadotropic and physiological functions in bumblebee Bombus terrestris
| | Uses | trans-trans-10,11-Epoxy Farnesenic Acid Methyl Ester is a metabolite (2E,6E)-Farnesenic Acid. | | Biochem/physiol Actions | JHBPs (JH-binding proteins) protect JH (juvenile hormone) from JH esterase- and epoxide hydrolase-mediated degradation. They also help in delivering JH to target tissues. |
| | JUVENILE HORMONE III Preparation Products And Raw materials |
|