|
|
| | 4-Methoxymethyl-2,3,5,6-tetrafluorobenzyl alcohol Basic information |
| Product Name: | 4-Methoxymethyl-2,3,5,6-tetrafluorobenzyl alcohol | | Synonyms: | 2,3,5,6-Tetrafluoro-4-methoxybenzyl alcohol;4-Methoxymethyl-2,3,5,6-Tetrafluorobenzyl;2,3,5,6-TETRAFLUORO-4-(METHOXYMETHYL)BENZYL ALCOHOL;4-METHOXYMETHYL-2,3,5,6-TERAFLUOROBENZENMETHANOL;4-Methoxymethyl-2,3,5,6-tetrafluorobenzyl alcohol;4-Methoxymethyl-2,3,5,6-Tetrafluorobenzene;4-Methoxy-2;6-tetrafluorobenzyl alcohol | | CAS: | 83282-91-1 | | MF: | C9H8F4O2 | | MW: | 224.15 | | EINECS: | 1592732-453-0 | | Product Categories: | Benzhydrols, Benzyl & Special Alcohols | | Mol File: | 83282-91-1.mol |  |
| | 4-Methoxymethyl-2,3,5,6-tetrafluorobenzyl alcohol Chemical Properties |
| Melting point | 51-53°C | | Boiling point | 214 ºC | | density | 1.407 | | Fp | 107 ºC | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol | | form | Solid | | pka | 12.85±0.10(Predicted) | | color | White | | InChI | InChI=1S/C9H8F4O2/c1-15-3-5-8(12)6(10)4(2-14)7(11)9(5)13/h14H,2-3H2,1H3 | | InChIKey | YFHZSPDQKWFAPH-UHFFFAOYSA-N | | SMILES | C1(CO)=C(F)C(F)=C(COC)C(F)=C1F | | CAS DataBase Reference | 83282-91-1(CAS DataBase Reference) |
| HazardClass | IRRITANT | | HS Code | 2906290090 |
| | 4-Methoxymethyl-2,3,5,6-tetrafluorobenzyl alcohol Usage And Synthesis |
| Uses | 4-Methoxymethyl-2,3,5,6-tetrafluorobenzyl Alcohol is used as a reagent in the synthesis of Metofluthrin; a potent new synthetic pyrethroid with high vapor activity against mosquitos. |
| | 4-Methoxymethyl-2,3,5,6-tetrafluorobenzyl alcohol Preparation Products And Raw materials |
|