- Detomidine
-
- $10.00
-
2026-06-05
- CAS:76631-46-4
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 100kg
- Detomidine
-
- $1520.00
-
2026-05-11
- CAS:76631-46-4
- Purity:
- Supply Ability: 10g
- Detomidine
-
- $15.00
-
2021-07-13
- CAS:76631-46-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE Basic information |
| Product Name: | 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE | | Synonyms: | 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE;1H-Imidazole, 4-((2,3-dimethylphenyl)methyl)-;4-(2,3-Dimethylbenzyl)imidazol;Detomidina;Detomidina [inn-spanish];Detomidine [inn:ban];Detomidinum;Detomidinum [inn-latin] | | CAS: | 76631-46-4 | | MF: | C12H14N2 | | MW: | 186.25 | | EINECS: | 202-303-5 | | Product Categories: | | | Mol File: | 76631-46-4.mol |  |
| | 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE Chemical Properties |
| Melting point | 114-116° | | Boiling point | 386.5±11.0 °C(Predicted) | | density | 1.077±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.44±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C12H14N2/c1-9-4-3-5-11(10(9)2)6-12-7-13-8-14-12/h3-5,7-8H,6H2,1-2H3,(H,13,14) | | InChIKey | RHDJRPPFURBGLQ-UHFFFAOYSA-N | | SMILES | CC1=C(C=CC=C1C)CC2=CN=CN2 | | SMILES | C1NC(CC2=CC=CC(C)=C2C)=CN=1 |
| Toxicity | LD50 i.v. in mice: 35 mg/kg (Karjalayne, Kurkela) |
| | 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE Usage And Synthesis |
| Uses | Detomidine is a α-Adrenoceptor agonist with sedative and analgesic activity. Sedative. | | Uses | Analgesic (veterinary); sedative-hypnotic. |
| | 4-(2,3-DIMETHYL-BENZYL)-1H-IMIDAZOLE Preparation Products And Raw materials |
|