|
|
| | 7-chloro-1,3-dihydro-5-phenyl-2-oxo-2H-1,4-benzodiazepin-3-yl acetate Basic information |
| Product Name: | 7-chloro-1,3-dihydro-5-phenyl-2-oxo-2H-1,4-benzodiazepin-3-yl acetate | | Synonyms: | 7-chloro-1,3-dihydro-5-phenyl-2-oxo-2H-1,4-benzodiazepin-3-yl acetate;3-ACETOXY-7-CHOLRO-1,3-DIHYDRO-5-PHENYL-2H-1,4-BENZODIAZEPIN-2-ONE;oxazepam acetate;3-Acetyloxy-7-chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepin-2-one;Oxazepam 3-acetate;(7-chloro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) acetate;(7-chloro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) ethanoate;acetic acid (7-chloro-2-keto-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) ester | | CAS: | 1824-74-4 | | MF: | C17H13ClN2O3 | | MW: | 328.75 | | EINECS: | 217-359-6 | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 1824-74-4.mol |  |
| | 7-chloro-1,3-dihydro-5-phenyl-2-oxo-2H-1,4-benzodiazepin-3-yl acetate Chemical Properties |
| Melting point | 242-243 °C | | Boiling point | 497.8±45.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 10.48±0.70(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H13ClN2O3/c1-10(21)23-17-16(22)19-14-8-7-12(18)9-13(14)15(20-17)11-5-3-2-4-6-11/h2-9,17H,1H3,(H,19,22) | | InChIKey | FYRWUTOZBRWYCS-UHFFFAOYSA-N | | SMILES | Clc1cc2c(cc1)NC(=O)C(N=C2c3ccccc3)OC(=O)C |
| WGK Germany | WGK 3 | | HS Code | 2933998350 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
STOT SE 3 |
| | 7-chloro-1,3-dihydro-5-phenyl-2-oxo-2H-1,4-benzodiazepin-3-yl acetate Usage And Synthesis |
| Uses | A benzodiazepine derivative with anticonvulsant and muscle relaxant properties. An ester of Oxazepam (O845700).
Controlled Substance. |
| | 7-chloro-1,3-dihydro-5-phenyl-2-oxo-2H-1,4-benzodiazepin-3-yl acetate Preparation Products And Raw materials |
|