|
|
| | hexamethyl diorthosilicate Basic information |
| Product Name: | hexamethyl diorthosilicate | | Synonyms: | hexamethyl diorthosilicate;Hexamethoxypropanedisiloxane;Einecs 224-467-7;Hexamethoxy Disiloxane;Hexamethyl diorthosilicate Hexamethyl diorthosilicate;Hexamethyl diorthosilicate Hexamethyl diorth;Silicic acid (H6Si2O7), hexamethyl ester | | CAS: | 4371-91-9 | | MF: | C6H18O7Si2 | | MW: | 258.37 | | EINECS: | 224-467-7 | | Product Categories: | | | Mol File: | 4371-91-9.mol |  |
| | hexamethyl diorthosilicate Chemical Properties |
| Boiling point | 73 °C(Press: 3 Torr) | | density | 1.1222 g/cm3 | | refractive index | 1.38 | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C6H18O7Si2/c1-7-14(8-2,9-3)13-15(10-4,11-5)12-6/h1-6H3 | | InChIKey | XOAJIYVOSJHEQB-UHFFFAOYSA-N | | SMILES | [Si](OC)(OC)(OC)O[Si](OC)(OC)OC |
| | hexamethyl diorthosilicate Usage And Synthesis |
| | hexamethyl diorthosilicate Preparation Products And Raw materials |
|