| Company Name: |
ShangHai Anpel Co, Ltd. Gold
|
| Tel: |
18502138905 |
| Email: |
shanpel@anpel.com.cn |
| Products Intro: |
Product Name:2-Quinoxalinecarboxylic acid-[D4
CAS:2244217-89-6
Purity:24.19 Package:5mg Remarks:CDAA-S-510004D4-AA-1.2ml
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Quinoxaline-2-carboxylic acid-d4
CAS:2244217-89-6
Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
Artis Biotech Co. Ltd.
|
| Tel: |
18108108965 18108108965 |
| Email: |
sales@artisbio.com |
| Products Intro: |
Product Name:2-Quinoxalinecarboxylic acid-d4
CAS:2244217-89-6
Purity:98%HPLC Package:1mg;5mg;10mg;50mg
|
| Company Name: |
ChengDu SinoStandards Bio-Tech Co.,Ltd. ，
|
| Tel: |
028-83243028 19136088901 |
| Email: |
sinostandards@163.com |
| Products Intro: |
Product Name:2-Quinoxalinecarboxylic Acid-D4 (QCA-D4)
CAS:2244217-89-6
Purity:標準品 Package:10mg;100mg;1g
|
2-Quinoxaline-5,6,7,8-d4-carboxylic acid manufacturers
|
| | 2-Quinoxaline-5,6,7,8-d4-carboxylic acid Basic information |
| | 2-Quinoxaline-5,6,7,8-d4-carboxylic acid Chemical Properties |
| form | Solid | | color | Brown to red | | InChI | InChI=1S/C9H6N2O2/c12-9(13)8-5-10-6-3-1-2-4-7(6)11-8/h1-5H,(H,12,13) | | InChIKey | UPUZGXILYFKSGE-UHFFFAOYSA-N | | SMILES | C(C1C=NC2C([H])=C([H])C([H])=C([H])C=2N=1)(=O)O |
| | 2-Quinoxaline-5,6,7,8-d4-carboxylic acid Usage And Synthesis |
| Uses | 2-Quinoxalinecarboxylic acid-d4 is the deuterium labeled Fmoc-Pro-OH[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-223. DOI:10.1080/02688697.2018.1500521 |
| | 2-Quinoxaline-5,6,7,8-d4-carboxylic acid Preparation Products And Raw materials |
|