|
|
| | 4'-(pyrimidin-2-ylsulphamoyl)acetanilide Basic information |
| | 4'-(pyrimidin-2-ylsulphamoyl)acetanilide Chemical Properties |
| Melting point | 260-262C | | density | 1.3845 (rough estimate) | | refractive index | 1.6200 (estimate) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 6.08±0.10(Predicted) | | color | White | | Water Solubility | 0.15g/L(37 ºC) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C12H12N4O3S/c1-9(17)15-10-3-5-11(6-4-10)20(18,19)16-12-13-7-2-8-14-12/h2-8H,1H3,(H,15,17)(H,13,14,16) | | InChIKey | NJIZUWGMNCUKGU-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(Nc2ncccn2)c1ccc(cc1)NC(=O)C |
| | 4'-(pyrimidin-2-ylsulphamoyl)acetanilide Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A major metabolite of Sulfadiazine | | Definition | ChEBI: A sulfonamide that is benzenesulfonamide substituted by an acetylamino group at position 4 and a pyrimidin-2-yl group at the nitrogen atom. It is a metabolite of the drug sulfadiazine. |
| | 4'-(pyrimidin-2-ylsulphamoyl)acetanilide Preparation Products And Raw materials |
|