|
|
| | 4-((Trimethylsilyl)ethynyl)benzoic acid Basic information |
| | 4-((Trimethylsilyl)ethynyl)benzoic acid Chemical Properties |
| Melting point | 154-158°C | | Boiling point | 299.3±32.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Pale cream/peach, shiny flakes | | pka | 3.91±0.10(Predicted) | | InChI | 1S/C12H14O2Si/c1-15(2,3)9-8-10-4-6-11(7-5-10)12(13)14/h4-7H,1-3H3,(H,13,14) | | InChIKey | GUFYYXWHDBOLBG-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)C#Cc1ccc(cc1)C(O)=O |
| WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | 4-((Trimethylsilyl)ethynyl)benzoic acid Usage And Synthesis |
| | 4-((Trimethylsilyl)ethynyl)benzoic acid Preparation Products And Raw materials |
|