|
|
| | POLYGLYCERYL-10 OLEATE Basic information |
| Product Name: | POLYGLYCERYL-10 OLEATE | | Synonyms: | 1,2,3-Propanetriol, homopolymer, (9Z)-9-octadecenoate;POLYGLYCERINOLEATE;1,2,3-Propantriol, Homopolymer, (Z)-9-octadecenoat, mittlere Molmasse ca. 1000-1200 g/mol (1000-1200 d);1,2,3-Propanetriol, homopolymer, (Z)-9-octadecenoate;Oleic acid, ester with 1,2,3-propanetriol homopolymer;POLYGLYCERYL MONOLEATE);Glycolube(R) 740;Polyaldo(R) 10-1-0 KFG | | CAS: | 9007-48-1 | | MF: | C21H42O5 | | MW: | 374.56 | | EINECS: | 618-437-6 | | Product Categories: | Polymers | | Mol File: | 9007-48-1.mol |  |
| | POLYGLYCERYL-10 OLEATE Chemical Properties |
| Melting point | <0 °C | | Major Application | pharmaceutical (small molecule) | | Cosmetics Ingredients Functions | SURFACTANT - EMULSIFYING SKIN CONDITIONING - EMOLLIENT | | InChIKey | RAIRMBHOCCUQAG-ALCCZGGFSA-N | | SMILES | O(CC(O)CO)C(=O)C(C(C(C(CC(O)CO)CCC\C=C/CCCCCCCCCC(O)CO)CC(O)CO)CC(O)CO)CC(O)CO | | LogP | -4.147 (est) | | EPA Substance Registry System | Polyglyceryl oleate (9007-48-1) |
| WGK Germany | WGK 1 | | TSCA | TSCA listed | | HS Code | 3907200000 | | Storage Class | 11 - Combustible Solids |
| | POLYGLYCERYL-10 OLEATE Usage And Synthesis |
| Chemical Properties | POLYGLYCERYL-10 OLEATE is Waxy Solid | | Uses | POLYGLYCERYL-10 OLEATE is used as a polysorbate replacer, a dispersing agent, and an emulsifier in foods such as ice cream and in personal care products. | | Uses | Glycolube(R) 740 is used as an internal lubricant for PVC sheet and film and as an anti-fog agent in plasticized PVC film formulations. |
| | POLYGLYCERYL-10 OLEATE Preparation Products And Raw materials |
|