| Company Name: |
Hangzhou Huarong Pharm Co., Ltd. |
| Tel: |
571-86758373 +8613588754946 |
| Email: |
sales@huarongpharm.com |
| Products Intro: |
Product Name:(2R,3R)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol compound with (2S,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol (1:1)
CAS:137330-52-0
Purity:0.99 Package:10MG,50MG,100MG,1G
|
|
|
|
|
- Voriconazole
-
- $1.00
-
2019-12-24
- CAS:137330-52-0
- Min. Order: 1g
- Purity: 99.99%
- Supply Ability: 200kg
|
| | rel-(R,R)-Voriconazole Basic information |
| Product Name: | rel-(R,R)-Voriconazole | | Synonyms: | rel-(R,R)-Voriconazole;rel-(αR,βR)-α-(2,4-Difluorophenyl)-5-fluoro-β-Methyl-α-(1H-1,2,4-triazol-1-ylMethyl)-4-pyriMidineethanol;(2R,3R)-2-(2,4-difluorophenyl)-3-(5-fluoropyriMidin-4-yl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol;Azilsartan medoxomil impurity318;(2R,3R)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol compound with (2S,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol (1:1);4-Pyrimidineethanol, α-(2,4-difluorophenyl)-5-fluoro-β-methyl-α-(1H-1,2,4-triazol-1-ylmethyl)-, (R*,R*)- (9CI);Voriconazole Impurity 28;Voriconazole Related Compound A(USP) | | CAS: | 137330-52-0 | | MF: | C16H14F3N5O | | MW: | 349.31 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 137330-52-0.mol |  |
| | rel-(R,R)-Voriconazole Chemical Properties |
| Boiling point | 508.6±60.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, sealed storage, away from moisture | | solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) | | pka | 11.54±0.29(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C16H14F3N5O/c1-10(15-14(19)5-20-7-22-15)16(25,6-24-9-21-8-23-24)12-3-2-11(17)4-13(12)18/h2-5,7-10,25H,6H2,1H3/t10-,16-/s3 | | InChIKey | BCEHBSKCWLPMDN-OHNRHGLTNA-N | | SMILES | C([n]1ncnc1)[C@@](O)(c1ccc(F)cc1F)[C@@H](C)c1c(F)cncn1 |&1:6,16,r| |
| | rel-(R,R)-Voriconazole Usage And Synthesis |
| Uses | The (R,R)-enantiomer of Voriconazole. An antifungal (systemic). An ergosterol biosynthesis inhibitor. |
| | rel-(R,R)-Voriconazole Preparation Products And Raw materials |
|