|
|
| | Methyl-1-aminocyclohexane carboxylate (free base) Basic information |
| | Methyl-1-aminocyclohexane carboxylate (free base) Chemical Properties |
| Boiling point | 209.9±23.0 °C(Predicted) | | density | 1.047±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 7.19±0.70(Predicted) | | InChI | InChI=1S/C8H15NO2/c1-11-7(10)8(9)5-3-2-4-6-8/h2-6,9H2,1H3 | | InChIKey | KRDTUMQGDPZWMF-UHFFFAOYSA-N | | SMILES | C1(N)(C(OC)=O)CCCCC1 |
| HazardClass | IRRITANT | | HS Code | 2922498590 |
| | Methyl-1-aminocyclohexane carboxylate (free base) Usage And Synthesis |
| Description | Polyurethane is one of the six promising synthetic materials in the world and is widely used in plastics, rubber, fibers, coatings and adhesives. Isocyanates are the basic raw materials for the synthesis of polyurethanes. | | Uses | Methyl 1-aminocyclohexanecarboxylate is an amino acid compound that can be used as a biochemical reagent. | | Synthesis | Methyl 1-aminocyclohexanecarboxylate was synthesized from methanol and 1-amino-1-cyclohexylcarboxylate with a yield of about 88%. | | References | [1] Patent: WO2007/46550, 2007, A1. Location in patent: Page/Page column 124 [2] Patent: WO2008/4698, 2008, A2. Location in patent: Page/Page column 130 [3] Patent: WO2011/144584, 2011, A1. Location in patent: Page/Page column 52-53 |
| | Methyl-1-aminocyclohexane carboxylate (free base) Preparation Products And Raw materials |
|