| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Dimethyl 2-[(chloroacetyl)amino]terephthalate CAS:325763-68-6
|
|
| | AKOS B015656 Basic information |
| Product Name: | AKOS B015656 | | Synonyms: | AKOS B015656;ART-CHEM-BB B015656;CHEMBRDG-BB 3015656;Dimethyl 2-[(chloroacetyl)amino]terephthalate;dimethyl 2-[(chloroacetyl)amino]terephthalate(SALTDATA: FREE);IVK/9083903;ZINC02597265;Dimethyl 2-(2-chloroacetamido)terephthalate | | CAS: | 325763-68-6 | | MF: | C12H12ClNO5 | | MW: | 285.68 | | EINECS: | | | Product Categories: | | | Mol File: | 325763-68-6.mol |  |
| | AKOS B015656 Chemical Properties |
| form | solid | | InChI | 1S/C12H12ClNO5/c1-18-11(16)7-3-4-8(12(17)19-2)9(5-7)14-10(15)6-13/h3-5H,6H2,1-2H3,(H,14,15) | | InChIKey | MCJXWDAWSRTYBH-UHFFFAOYSA-N | | SMILES | ClCC(=O)Nc1c(ccc(c1)C(=O)OC)C(=O)OC |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | AKOS B015656 Usage And Synthesis |
| | AKOS B015656 Preparation Products And Raw materials |
|