5-hexylbenzene-1,3-diol manufacturers
|
| | 5-hexylbenzene-1,3-diol Basic information |
| Product Name: | 5-hexylbenzene-1,3-diol | | Synonyms: | 5-hexylbenzene-1,3-diol;1,3-Benzenediol, 5-hexyl-;Nsc28994;3,5-Dihydroxyhexylbenzene;5-hexyl-1,3-benzenediol;5-Hexylresorcinol | | CAS: | 5465-20-3 | | MF: | C12H18O2 | | MW: | 194.27 | | EINECS: | 200-001-8 | | Product Categories: | | | Mol File: | 5465-20-3.mol |  |
| | 5-hexylbenzene-1,3-diol Chemical Properties |
| Boiling point | 192-195 °C | | density | 1.049±0.06 g/cm3(Predicted) | | pka | 9.77±0.11(Predicted) | | InChI | InChI=1S/C12H18O2/c1-2-3-4-5-6-10-7-11(13)9-12(14)8-10/h7-9,13-14H,2-6H2,1H3 | | InChIKey | XECRVULUEJSGBY-UHFFFAOYSA-N | | SMILES | C1(O)=CC(CCCCCC)=CC(O)=C1 |
| | 5-hexylbenzene-1,3-diol Usage And Synthesis |
| Uses | 5-Hexyl Resorcinol is a resorcinol derivative isolated from Gmelina arborea. A potential antibacterial agent | | Synthesis Reference(s) | The Journal of Organic Chemistry, 37, p. 2901, 1972 DOI: 10.1021/jo00983a025 |
| | 5-hexylbenzene-1,3-diol Preparation Products And Raw materials |
|