|
|
| | 5,10-Dimethyldihydrophenazine Basic information |
| Product Name: | 5,10-Dimethyldihydrophenazine | | Synonyms: | 5,10-DIMETHYLDIHYDROPHENAZINE;5,10-DIHYDRO-5,10-DIMETHYLPHENAZINE 98%;5,10-Dimethyldihydro;3,5-difluoro-4'-pentylcyclohexyl;5,10-Dimethyldihydrophezine;5,10-dimethyl-1,2-dihydrophenazine;5,10-Dihydro-5,10-dimethylphenazine>;Phenazine, 5,10-dihydro-5,10-dimethyl- | | CAS: | 15546-75-5 | | MF: | C14H14N2 | | MW: | 210.27 | | EINECS: | 203-037-2 | | Product Categories: | Heterocyclic Building Blocks;N-Containing;Others | | Mol File: | 15546-75-5.mol |  |
| | 5,10-Dimethyldihydrophenazine Chemical Properties |
| Melting point | 150-152 °C (dec.)(lit.) | | Boiling point | 339.4±12.0 °C(Predicted) | | density | 1.117±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | pka | 3.82±0.20(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C14H14N2/c1-15-11-7-3-5-9-13(11)16(2)14-10-6-4-8-12(14)15/h3-10H,1-2H3 | | InChIKey | GVTGSIMRZRYNEI-UHFFFAOYSA-N | | SMILES | C1=C2C(N(C)C3=C(N2C)C=CC=C3)=CC=C1 | | CAS DataBase Reference | 15546-75-5(CAS DataBase Reference) |
| | 5,10-Dimethyldihydrophenazine Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder | | Synthesis Reference(s) | Journal of the American Chemical Society, 79, p. 6178, 1957 DOI: 10.1021/ja01580a019 |
| | 5,10-Dimethyldihydrophenazine Preparation Products And Raw materials |
|