|
|
| | 3-Aminophenylboronic acid pinacol ester Basic information |
| Product Name: | 3-Aminophenylboronic acid pinacol ester | | Synonyms: | 3-AMINOPHENYLBORONIC ACID, PINACOL CYCLIC ESTER;3-AMINOPHENYLBORONIC ACID PINACOL ESTER;3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-ANILINE 97%;3-Aminobenzeneboronic acid pinacol ester, 97%;3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)aniline,97%;3-(tetraMethyl-1,3,2-dioxaborolan-2-yl)aniline;3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)aniline(3-AMinophenylboronic acid pinacol ester);3-Aminophenylboronic acid pinacol ester
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)aniline | | CAS: | 210907-84-9 | | MF: | C12H18BNO2 | | MW: | 219.09 | | EINECS: | | | Product Categories: | CHIRAL CHEMICALS | | Mol File: | 210907-84-9.mol |  |
| | 3-Aminophenylboronic acid pinacol ester Chemical Properties |
| Melting point | 90-94 °C (lit.) | | Boiling point | 351.2±25.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | very soluble in Methanol | | form | solid | | pka | 4.56±0.10(Predicted) | | color | white to brown | | Water Solubility | Insoluble | | InChI | 1S/C12H18BNO2/c1-11(2)12(3,4)16-13(15-11)9-6-5-7-10(14)8-9/h5-8H,14H2,1-4H3 | | InChIKey | YMXIIVIQLHYKOT-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2cccc(N)c2 | | CAS DataBase Reference | 210907-84-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-36 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ACROS
| English |
| | 3-Aminophenylboronic acid pinacol ester Usage And Synthesis |
| Chemical Properties | light brown crystals or powder | | Uses | 3-Aminophenylboronic acid pinacol ester can be used:
As a starting material for the synthesis of 6-(hetero)arylthieno[3,2-b]pyridines, which are known to inhibit human tumor cells selectively.
In the functionalization of deuteroporphyrin IX dimethyl ester through Suzuki-Miyaura coupling.
To prepare benzo[d]oxazole based type-I FLT3-ITD inhibitors. |
| | 3-Aminophenylboronic acid pinacol ester Preparation Products And Raw materials |
|