| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:S-(+)-N-DesMethyl Mephenytoin CAS:65567-34-2 Package:250Mg,25Mg
|
| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:(S)-(+)-NIRVANOL CAS:65567-34-2 Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
|
| | (S)-(+)-NIRVANOL Basic information |
| | (S)-(+)-NIRVANOL Chemical Properties |
| Melting point | 195-200°C | | storage temp. | 2-8°C | | solubility | DMF: soluble | | form | Solid | | color | off-white | | InChI | 1S/C11H12N2O2/c1-2-11(8-6-4-3-5-7-8)9(14)12-10(15)13-11/h3-7H,2H2,1H3,(H2,12,13,14,15)/t11-/m0/s1 | | InChIKey | UDTWZFJEMMUFLC-NSHDSACASA-N | | SMILES | CC[C@]1(NC(=O)NC1=O)c2ccccc2 |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38-20/21/22 | | Safety Statements | 26-37/39-36 | | WGK Germany | 2 | | RTECS | MU2452000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(+)-NIRVANOL Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | An anticonvulsant, hypnotic. A metabolite of Mephentoin. | | Definition | ChEBI: S-nirvanol is an imidazolidine-2,4-dione. | | Biological Activity | 5-ethyl-5-phenylhydantoin (EPH) is a long-acting sedative. It is implicated to favor hepatocellular and thyroid follicular cell tumor progression.', 'CYP2B6 metabolite of (R)-(-)-mephenytoin; anticonvulsant; hypnotic. |
| | (S)-(+)-NIRVANOL Preparation Products And Raw materials |
|