| Company Name: |
Lanzhou Kangyuxin Biotechnology Co., Ltd.
|
| Tel: |
0943-8293106 |
| Email: |
sales@kyxpharma.com |
| Products Intro: |
Product Name:11-(3-chlorophenyl)phenanthro[9',10':4,5]furo[2,3-b]pyrazine CAS:2271196-36-0 Purity:97% HPLC Package:50KG 25KG 10KG 1KG
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58859352 18651614124 |
| Email: |
2881516338@qq.com |
| Products Intro: |
Product Name:11-(3-Chlorophenyl)phenanthro[9′,10′:4,5]furo[2,3-b]pyrazine CAS:2271196-36-0 Purity:95%+ Package:1g;5g;10g
|
Phenanthro[9′,10′:4,5]furo[2,3-b]pyrazine, 11-(3-chlorophenyl)- manufacturers
|
| | Phenanthro[9′,10′:4,5]furo[2,3-b]pyrazine, 11-(3-chlorophenyl)- Basic information |
| Product Name: | Phenanthro[9′,10′:4,5]furo[2,3-b]pyrazine, 11-(3-chlorophenyl)- | | Synonyms: | Phenanthro[9′,10′:4,5]furo[2,3-b]pyrazine, 11-(3-chlorophenyl)-;11-(3-chlorophenyl)phenanthro[9',10':4,5]furo[2,3-b]pyrazine | | CAS: | 2271196-36-0 | | MF: | C24H13ClN2O | | MW: | 380.83 | | EINECS: | | | Product Categories: | | | Mol File: | 2271196-36-0.mol | ![Phenanthro[9′,10′:4,5]furo[2,3-b]pyrazine, 11-(3-chlorophenyl)- Structure](CAS/20240320/GIF/2271196-36-0.gif) |
| | Phenanthro[9′,10′:4,5]furo[2,3-b]pyrazine, 11-(3-chlorophenyl)- Chemical Properties |
| Boiling point | 624.108±50.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.398±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | -0.935±0.40(predicted) | | InChI | InChI=1S/C24H13ClN2O/c25-15-7-5-6-14(12-15)20-13-26-22-21-18-10-3-1-8-16(18)17-9-2-4-11-19(17)23(21)28-24(22)27-20/h1-13H | | InChIKey | GMTVLTIAOHIOEO-UHFFFAOYSA-N | | SMILES | ClC1=CC=CC(=C1)C1=CN=C2C(=N1)OC1=C3C=CC=CC3=C3C=CC=CC3=C12 |
| | Phenanthro[9′,10′:4,5]furo[2,3-b]pyrazine, 11-(3-chlorophenyl)- Usage And Synthesis |
| Uses | Phenanthro[9′,10′:4,5]furo[2,3-b]pyrazine, 11-(3-chlorophenyl)- is a dedicated intermediate for organic photoelectric synthesis, used as a core acceptor building block for OLED red TADF luminescent materials and small molecules of electron transport layers, and also used in the research and development of organic photovoltaic conjugated frameworks and fluorescent probes. |
| | Phenanthro[9′,10′:4,5]furo[2,3-b]pyrazine, 11-(3-chlorophenyl)- Preparation Products And Raw materials |
|