|
|
| | (R)-3-Amino-4-(2,4,5-trifluorophenyl)butyric acid Basic information |
| Product Name: | (R)-3-Amino-4-(2,4,5-trifluorophenyl)butyric acid | | Synonyms: | (R)-3-Amino-4-(2,4,5-Trifluorophenyl)butyric Acid Hydrochloride;(R)-3-Amino-4-(2,4,5-trifluorophenyl)butyric acid;Tert-butyl(R)-1-(methoxycarbonyl)-3-(2,4,5-trifluorophenyl)propan-2-ylcarbamatetert-butyl(R)-1-(methoxycarbonyl)-3-47(2,4,5-trifluorophenyl)propan-2-ylcarbamate;Benzenebutanoic acid, .beta.-aMino-2,4,5-trifluoro-, (.beta.R)-;Sitagliptin-butanoic acid;tert-butyl (R)-1-(Methoxycarbonyl)-3-(2,4,5-trifluorophenyl)propan-2-ylcarbaMate;Benzenebutanoic acid, b-aMino-2,4,5-trifluoro-, (bR)-;Benzenebutanoic acid, β-aMino-2,4,5-trifluoro-, (βR)- | | CAS: | 936630-57-8 | | MF: | C10H10F3NO2 | | MW: | 233.19 | | EINECS: | 1308068-626-2 | | Product Categories: | | | Mol File: | 936630-57-8.mol |  |
| | (R)-3-Amino-4-(2,4,5-trifluorophenyl)butyric acid Chemical Properties |
| Melting point | 217-219 °C(Solv: water (7732-18-5); acetone (67-64-1)) | | Boiling point | 326.6±42.0 °C(Predicted) | | density | 1.399 | | storage temp. | 2-8°C(protect from light) | | pka | 3.66±0.10(Predicted) | | Appearance | White to off-white Solid | | Major Application | pharmaceutical small molecule | | InChI | InChI=1/C10H10F3NO2/c11-7-4-9(13)8(12)2-5(7)1-6(14)3-10(15)16/h2,4,6H,1,3,14H2,(H,15,16)/t6-/s3 | | InChIKey | KEFQQJVYCWLKPL-ISZMHOAENA-N | | SMILES | C1(F)C(F)=CC(F)=C(C[C@@H](N)CC(O)=O)C=1 |&1:9,r| |
| WGK Germany | WGK 3 | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-3-Amino-4-(2,4,5-trifluorophenyl)butyric acid Usage And Synthesis |
| Uses | pharmaceutical small molecule |
| | (R)-3-Amino-4-(2,4,5-trifluorophenyl)butyric acid Preparation Products And Raw materials |
| Raw materials | Benzenebutanoic acid, β-amino-2,4,5-trifluoro-, ethyl ester, (βS)--->(R)-N-(2-benzoyl-4-chlorophenyl)-1-(3,4-dichlorobenzyl)pyrrolidine-2-carboxamide-->Benzenebutanoic acid, β-(benzoylamino)-2,4,5-trifluoro-, methyl ester, (βR)--->1246961-45-4-->(R)-3-(Benzyloxyamino)-4-(2,4,5-trifluorophenyl)butanoic acid-->ethyl 3-amino-4-(2,4,5-trifluorophenyl)butanoate-->(R)-Ethyl 2,4,5-trifluoro-b-homophenylalaninateHCl | | Preparation Products | Benzenebutanoicacid,b-aMino-2,4,5-trifluoro-,Methylester,(bR)--->(R)-3-AMino-4-(2,4,5-trifluoro-phenyl)-butyric acid hydrochloride-->Boc-(R)-3-Amino-4-(2,4,5-trifluorophenyl)butanoic acid |
|