- Z-D-TYR-OH
-
-
2026-06-05
- CAS:64205-12-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- Z-D-TYR-OH
-
- $100.00
-
2019-07-06
- CAS:64205-12-5
- Min. Order: 1KG
- Purity: 99%
|
| | Z-D-TYR-OH Basic information |
| | Z-D-TYR-OH Chemical Properties |
| Melting point | 99 °C | | Boiling point | 570.8±50.0 °C(Predicted) | | density | 1.323 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 2.97±0.10(Predicted) | | color | White to Light yellow | | Optical Rotation | Consistent with structure | | BRN | 6071009 | | Major Application | peptide synthesis | | InChI | 1S/C17H17NO5/c19-14-8-6-12(7-9-14)10-15(16(20)21)18-17(22)23-11-13-4-2-1-3-5-13/h1-9,15,19H,10-11H2,(H,18,22)(H,20,21)/t15-/m1/s1 | | InChIKey | MCRMUCXATQAAMN-OAHLLOKOSA-N | | SMILES | OC(=O)[C@@H](Cc1ccc(O)cc1)NC(=O)OCc2ccccc2 | | CAS DataBase Reference | 64205-12-5(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2922.50.4000 | | Storage Class | 13 - Non Combustible Solids |
| | Z-D-TYR-OH Usage And Synthesis |
| Uses | N-Cbz-D-tyrosine is an N-Cbz-protected form of D-Tyrosine (T899970). D-Tyrosine is an unnatural isomer of L-Tyrosine (T899975) that inhibits metabolic activity of Bacillus subtilis. It is known to exhibit antimetabolic effects on rats as well, inhibiting growth and development. D-Tyrosine is also a chiral precursor to biosynthesized inhibitors that have antiinflammatory effects in humans. |
| | Z-D-TYR-OH Preparation Products And Raw materials |
|