- 2-Bromothioanisole
-
-
2026-03-20
- CAS:19614-16-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 mt
- 2-Bromothioanisole
-
-
2025-04-04
- CAS:19614-16-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
|
| | 2-Bromothioanisole Basic information |
| Product Name: | 2-Bromothioanisole | | Synonyms: | 2-BROMOTHIOANISOLE;2-BROMOPHENYL METHYL SULFIDE;O-BROMOTHIOANISOLE;TIMTEC-BB SBB006566;1-BROMO-2-(METHYLTHIO)BENZENE;1-Bromo-2-(methylsulfanyl)benzene;o-Bromo(methylthio)benzene;o-Bromophenyl methyl sulfide | | CAS: | 19614-16-5 | | MF: | C7H7BrS | | MW: | 203.1 | | EINECS: | 243-183-4 | | Product Categories: | Miscellaneous;Thioderivates | | Mol File: | 19614-16-5.mol |  |
| | 2-Bromothioanisole Chemical Properties |
| Melting point | -24 °C (lit.) | | Boiling point | 145-146 °C/27 mmHg (lit.) | | density | 1.522 g/mL at 25 °C (lit.) | | refractive index | 1.632-1.634 | | Fp | >110°C | | storage temp. | Inert atmosphere,Room Temperature | | form | Liquid | | color | Clear colorless to yellow | | Specific Gravity | 1.522 | | BRN | 2243716 | | InChI | InChI=1S/C7H7BrS/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 | | InChIKey | ALAQDUSTXPEHMH-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC=C1SC | | CAS DataBase Reference | 19614-16-5(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-bromo-2-(methylthio)-(19614-16-5) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 37/39-26 | | RIDADR | UN 3334 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, STENCH | | HS Code | 29309090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Bromothioanisole Usage And Synthesis |
| Chemical Properties | clear yellow liquid | | Uses | 2-Bromothioanisole has been used in the preparation of:
- thioether-methyleneborane (PhSCH2B (C6F5)2)2
- 1-dimesitylboryl-2-methylthio-benzene
| | Synthesis | Under argon protection, sodium hydroxide (0.32 g, 7.9 mmol) was dissolved in ethanol (3.0 mL), and 2-bromothiophenol (1.0 g, 5.29 mmol) was added slowly and stirred for 30 min at room temperature. Subsequently, iodomethane (0.5 mL, 7.9 mmol) was added and the reaction continued to be stirred at room temperature for 3 hours. Upon completion of the reaction, the reaction was quenched by the addition of ice water (4.0 mL) and the reaction mixture was extracted with dichloromethane (10 mL x 3). The organic layers were combined, washed with saturated saline, dried over anhydrous sodium sulfate, filtered and concentrated under reduced pressure. The crude product was purified by fast column chromatography (eluent: petroleum ether) to afford the target compound 2-bromothioanisole. | | References | [1] Macromolecules, 2002, vol. 35, # 1, p. 67 - 78 [2] Tetrahedron Asymmetry, 2011, vol. 22, # 5, p. 575 - 579 [3] Patent: WO2015/86525, 2015, A1. Location in patent: Page/Page column 127 [4] Tetrahedron Asymmetry, 1999, vol. 10, # 6, p. 1051 - 1060 [5] Organic Letters, 2005, vol. 7, # 1, p. 143 - 145 |
| | 2-Bromothioanisole Preparation Products And Raw materials |
|