|
|
| | Tetrabenzylthiuramdisulfide Basic information |
| Product Name: | Tetrabenzylthiuramdisulfide | | Synonyms: | rubber accelerator tbztd;BENZYL TUADS;TetrabenzylThiuramDisulfide(Tbztd);Thioperoxydicarbonic diamide ((H2N)C(S)2S2), tetrakis(phenylmethyl)-;Tetrabenzylthiuramdisulfid;Bis(dibenzylthiocarbamoyl) persulfide;N,N,N',N'-Tetrabenzylthiuram disulfide;HiDispersion TBzTD-70 | | CAS: | 10591-85-2 | | MF: | C30H28N2S4 | | MW: | 544.82 | | EINECS: | 404-310-0 | | Product Categories: | | | Mol File: | 10591-85-2.mol |  |
| | Tetrabenzylthiuramdisulfide Chemical Properties |
| Melting point | 124°C | | Boiling point | 687.0±65.0 °C(Predicted) | | density | 1.288±0.06 g/cm3(Predicted) | | vapor pressure | 0.85-0.86Pa at 25℃ | | storage temp. | 2-8°C, stored under nitrogen | | solubility | 190 in mg/100g standard fat at 20 ℃ | | pka | 0.79±0.50(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | 10μg/L at 21℃ | | InChI | InChI=1S/C30H28N2S4/c33-29(31(21-25-13-5-1-6-14-25)22-26-15-7-2-8-16-26)35-36-30(34)32(23-27-17-9-3-10-18-27)24-28-19-11-4-12-20-28/h1-20H,21-24H2 | | InChIKey | WITDFSFZHZYQHB-UHFFFAOYSA-N | | SMILES | N(CC1=CC=CC=C1)(CC1=CC=CC=C1)C(SSC(N(CC1=CC=CC=C1)CC1=CC=CC=C1)=S)=S | | LogP | 3.7 at 20℃ | | CAS DataBase Reference | 10591-85-2(CAS DataBase Reference) | | EPA Substance Registry System | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetrakis(phenylmethyl)- (10591-85-2) |
| Risk Statements | 53 | | Safety Statements | 61 | | TSCA | TSCA listed |
| | Tetrabenzylthiuramdisulfide Usage And Synthesis |
| Uses | Tetrabenzylthiuram Disulfide is one of the many lubricating oil for fork truck bearing; Also, it is derived from Dibenzylamine (D417505), which is a chemical contaminant in L-(+)-β-hydroxybutyrate, exhibits direct anticonvulsant actions in vivo. | | Uses | Accelerator for NR, SBR and NBR | | Contact allergens | TBzTD is a rubber vulcanization accelerator. |
| | Tetrabenzylthiuramdisulfide Preparation Products And Raw materials |
|