|
|
| | (1,2-DIBROMOETHYL)BENZENE Basic information |
| | (1,2-DIBROMOETHYL)BENZENE Chemical Properties |
| Melting point | 70-74 °C (lit.) | | Boiling point | 139-141 °C/15 mmHg (lit.) | | density | 1.74 | | refractive index | 1.6113 (estimate) | | Fp | 139-140°C/15mm | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Crystalline Powder | | color | Light yellow to light brown | | BRN | 907323 | | InChI | InChI=1S/C8H8Br2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8H,6H2 | | InChIKey | SHKKTLSDGJRCTR-UHFFFAOYSA-N | | SMILES | C1(C(Br)CBr)=CC=CC=C1 | | CAS DataBase Reference | 93-52-7(CAS DataBase Reference) | | EPA Substance Registry System | Benzene, (1,2-dibromoethyl)- (93-52-7) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-25 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | CZ1800100 | | F | 8-19 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | (1,2-DIBROMOETHYL)BENZENE Usage And Synthesis |
| Chemical Properties | light yellow to light brown crystalline powder | | Uses | - Effects of the biocide methylisothiazolinone on Xenopus laevis wound healing and tail regeneration.: The study assesses the impact of 2-Methyl-4-isothiazolin-3-one on regenerative processes in amphibians, contributing to the understanding of its biological effects and potential toxicity (Delos Santos et al., 2016).
| | Synthesis Reference(s) | Journal of the American Chemical Society, 71, p. 1157, 1949 DOI: 10.1021/ja01172a007
Synthetic Communications, 25, p. 2203, 1995 DOI: 10.1080/00397919508011774 | | General Description | The metabolism of 1,2-dibromo-1-phenylethane in rat was examined. |
| | (1,2-DIBROMOETHYL)BENZENE Preparation Products And Raw materials |
|