|
|
| | N-Succinimidyl Methacrylate Basic information |
| Product Name: | N-Succinimidyl Methacrylate | | Synonyms: | N-Succinimidyl Methacrylate;Methacrylic Acid N-Succinimidyl Ester
N-Methacryloyloxysuccinimide;Methacrylic acid N-hydroxysuccinimide ester
;N-(Methacryloxy)succinimide;N-(Methacryloyloxy)succinimide;N-Succinimidyl Methacrylate;(2,5-dioxopyrrolidin-1-yl) 2-methylprop-2-enoate;2-Propenoic acid, 2-methyl-, 2,5-dioxo-1-pyrrolidinyl ester | | CAS: | 38862-25-8 | | MF: | C8H9NO4 | | MW: | 183.16 | | EINECS: | | | Product Categories: | | | Mol File: | 38862-25-8.mol |  |
| | N-Succinimidyl Methacrylate Chemical Properties |
| Melting point | 102.0 to 106.0 °C | | Boiling point | 270.1±23.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C8H9NO4/c1-5(2)8(12)13-9-6(10)3-4-7(9)11/h1,3-4H2,2H3 | | InChIKey | ACGJEMXWUYWELU-UHFFFAOYSA-N | | SMILES | CC(=C)C(=O)ON1C(=O)CCC1=O |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-43-48/20/22 | | Safety Statements | 26-36/37-45 | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | N-Succinimidyl Methacrylate Usage And Synthesis |
| Uses | Methacrylic acid N-hydroxysuccinimide ester can be copolymerized by reversible addition fragmentation chain transfer (RAFT) polymerization for bioconjugation with proteins. It can be used in the fabrication of a bionanocomposite for the removal of chromium from water. It can be copolymerized with poly(N-isopropylacrylamide) for potential usage in immunoassay, catalyst recovery and drug delivery. |
| | N-Succinimidyl Methacrylate Preparation Products And Raw materials |
|