| Company Name: |
Hangzhou J&H Chemical Co., Ltd. Gold
|
| Tel: |
0571-87396432 |
| Email: |
sales@jhechem.com |
| Products Intro: |
Product Name:4-chloro-5-ethyl-7H-pyrrolo[2,3-d]pyrimidine
CAS:1004992-44-2
Purity:98% HPLC Package:50KG;10KG;5KG;1KG;500g;100g;10g;1g;
|
| Company Name: |
CEG Chemical Science&Technology Co., Ltd.
|
| Tel: |
Mobile:13665161512 |
| Email: |
|
| Products Intro: |
Product Name:4-chloro-5-ethyl-7H-pyrrolo[2,3-d]pyriMidine
CAS:1004992-44-2
Purity:>95% Package:5g, 10g, 25g
|
|
| | 4-chloro-5-ethyl-7H-pyrrolo[2,3-d]pyriMidine Basic information |
| | 4-chloro-5-ethyl-7H-pyrrolo[2,3-d]pyriMidine Chemical Properties |
| storage temp. | Store at Room Tem. | | form | solid | | InChI | InChI=1S/C8H8ClN3/c1-2-5-3-10-8-6(5)7(9)11-4-12-8/h3-4H,2H2,1H3,(H,10,11,12) | | InChIKey | HXTUOLGGMWNTJZ-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=C2C(CC)=CNC2=N1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Skin Sens. 1 |
| | 4-chloro-5-ethyl-7H-pyrrolo[2,3-d]pyriMidine Usage And Synthesis |
| | 4-chloro-5-ethyl-7H-pyrrolo[2,3-d]pyriMidine Preparation Products And Raw materials |
|