|
|
| | 6-(benzyloxy)-3,4-dihydronaphthalen-1(2H)-one Basic information |
| Product Name: | 6-(benzyloxy)-3,4-dihydronaphthalen-1(2H)-one | | Synonyms: | 6-(benzyloxy)-3,4-dihydronaphthalen-1(2H)-one;1(2H)-Naphthalenone, 3,4-dihydro-6-(phenylMethoxy)-;6-(Benzyloxy)-3,4-dihydro-1(2H)-naphthalenone;oxy)-3,4-dihydronaphthaL;6-phenylmethoxy-3,4-dihydro-2H-naphthalen-1-one;6-(benzyloxy)-1,2,3,4-tetrahydronaphthalen-1-one;6-benzyloxytetralone;3,4-dihydro-6-(phenylmethoxy)-1(2H)-naphthaleneone | | CAS: | 32263-70-0 | | MF: | C17H16O2 | | MW: | 252.31 | | EINECS: | | | Product Categories: | | | Mol File: | 32263-70-0.mol |  |
| | 6-(benzyloxy)-3,4-dihydronaphthalen-1(2H)-one Chemical Properties |
| Melting point | 96-99 °C(Solv: cyclohexane (110-82-7)) | | Boiling point | 433.4±34.0 °C(Predicted) | | density | 1.160±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C17H16O2/c18-17-8-4-7-14-11-15(9-10-16(14)17)19-12-13-5-2-1-3-6-13/h1-3,5-6,9-11H,4,7-8,12H2 | | InChIKey | SAYPPJQQGVXKAP-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(OCC3=CC=CC=C3)C=C2)CCC1 |
| | 6-(benzyloxy)-3,4-dihydronaphthalen-1(2H)-one Usage And Synthesis |
| Synthesis | General procedure: 6-hydroxy-1-tetralone (0.3 g, 1.85 mmol) was suspended in acetone (15 mL) containing K2CO3 (3.70 mmol). Benzyl bromide (2.035 mmol) was added to the reaction mixture and heated under reflux conditions for 6 hours. The reaction process was monitored by silica gel thin layer chromatography (TLC) using ethyl acetate with petroleum ether (1:2) as mobile phase. Upon completion of the reaction, the mixture was filtered through a diatomaceous earth pad and the filtrate was subsequently concentrated under vacuum. The resulting crude product was purified by recrystallization from cyclohexane to give 6-(benzyloxy)-3,4-dihydronaphthalen-1(2H)-one. | | References | [1] Bioorganic and Medicinal Chemistry Letters, 2014, vol. 24, # 12, p. 2758 - 2763 [2] Patent: US2018/155322, 2018, A1. Location in patent: Paragraph 1502; 1503 [3] European Journal of Organic Chemistry, 2003, # 15, p. 2799 - 2812 [4] Bioorganic and Medicinal Chemistry Letters, 2012, vol. 22, # 1, p. 144 - 148 |
| | 6-(benzyloxy)-3,4-dihydronaphthalen-1(2H)-one Preparation Products And Raw materials |
|