|
|
| | 2-BIPHENYLYL GLYCIDYL ETHER Basic information |
| Product Name: | 2-BIPHENYLYL GLYCIDYL ETHER | | Synonyms: | (((1,1'-Biphenyl)-2-yloxy)methyl)oxirane;o-Phenylphenolglycidylether;opp-g;Oxirane, [([1,1'-biphenyl]-2-yloxy)methyl]-;Propane, 1-(2-biphenylyloxy)-2,3-epoxy-;Propane, 1,2-epoxy-3-(2-xenolyl)-;3-(2-Biphenylyloxy)-1,2-epoxypropane;biphenyl-2-yl 2,3-epoxypropyl ether | | CAS: | 7144-65-2 | | MF: | C15H14O2 | | MW: | 226.27 | | EINECS: | 230-451-0 | | Product Categories: | Biphenyl & Diphenyl ether | | Mol File: | 7144-65-2.mol |  |
| | 2-BIPHENYLYL GLYCIDYL ETHER Chemical Properties |
| Melting point | 31°C | | Boiling point | 200°C/13mmHg(lit.) | | density | 1.0891 (rough estimate) | | refractive index | 1.6530 (estimate) | | storage temp. | -20°C | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C15H14O2/c1-2-6-12(7-3-1)14-8-4-5-9-15(14)17-11-13-10-16-13/h1-9,13H,10-11H2 | | InChIKey | DNVXWIINBUTFEP-UHFFFAOYSA-N | | SMILES | O1CC1COC1=CC=CC=C1C1=CC=CC=C1 | | CAS DataBase Reference | 7144-65-2(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | RTECS | RR0356000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-BIPHENYLYL GLYCIDYL ETHER Usage And Synthesis |
| Chemical Properties | white to light yellow low melting solid |
| | 2-BIPHENYLYL GLYCIDYL ETHER Preparation Products And Raw materials |
|