- Euphorbia factor L1
-
- $2.00
-
2026-04-17
- CAS:76376-43-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- Euphorbia factor L1
-
-
2023-02-24
- CAS:76376-43-7
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Euphorbia factor L1 Basic information |
| Product Name: | Euphorbia factor L1 | | Synonyms: | EUPATOROXIN,10-EPI;(E)-1,1,3,6-tetramethyl-4-oxo-7-(2-phenylacetoxy)-1,1a,4,4a,5,6,7,7a,8,10,11,11a-dodecahydrospiro[cyclopenta[a]cyclopropa[f][11]annulene-9,2'-oxiran]-4a,8-diyl diacetate;Benzeneacetic acid, (1aR,2'S,4aR,6S,7S,7aR,8R,11aS)-4a,8-bis(acetyloxy)-1a,4a,5,6,7,7a,8,10,11,11a-decahydro-1,1,3,6-tetramethyl-4-oxospiro[9H-cyclopenta[a]cyclopropa[f]cycloundecene-9,2'-oxiran]-7-yl ester;euphoria factor L1;Euphorbia factor L1, 10 mM in DMSO;Euphorbia factor L1 (Standard) | | CAS: | 76376-43-7 | | MF: | C32H40O8 | | MW: | 552.66 | | EINECS: | | | Product Categories: | Diterpenoids;chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 76376-43-7.mol |  |
| | Euphorbia factor L1 Chemical Properties |
| Boiling point | 633.1±55.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | 4°C, protect from light | | solubility | Soluble in DMSO | | InChIKey | SDGDWRYYHQOQOJ-QZVJJNCDSA-N | | SMILES | C1(CC(O[C@@H]2[C@]3([H])[C@@H](OC(C)=O)[C@@]4(CO4)CC[C@]4([H])C(C)(C)[C@]4([H])C=C(C)C(=O)[C@@]3(OC(C)=O)C[C@@H]2C)=O)=CC=CC=C1 |c:26| |
| | Euphorbia factor L1 Usage And Synthesis |
| | Euphorbia factor L1 Preparation Products And Raw materials |
|